N-Benzyl-6-[4-(dimethylamino)phenyl]-7-methoxybenzo[d][1,3]dioxole-5-carboxamide

ID: ALA5090710

PubChem CID: 166635047

Max Phase: Preclinical

Molecular Formula: C24H24N2O4

Molecular Weight: 404.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1c2c(cc(C(=O)NCc3ccccc3)c1-c1ccc(N(C)C)cc1)OCO2

Standard InChI:  InChI=1S/C24H24N2O4/c1-26(2)18-11-9-17(10-12-18)21-19(13-20-22(23(21)28-3)30-15-29-20)24(27)25-14-16-7-5-4-6-8-16/h4-13H,14-15H2,1-3H3,(H,25,27)

Standard InChI Key:  FBVNXMFHIFAREF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    3.5480  -14.4040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5469  -15.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2549  -15.6325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9646  -15.2231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9617  -14.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2531  -13.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2479  -13.1808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9560  -12.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9539  -11.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5412  -12.7771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5356  -11.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2434  -11.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0693  -10.7480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2537  -10.6662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9240  -11.4165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8358  -13.1898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1258  -12.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6645  -13.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6661  -13.9951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3714  -12.7679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0799  -13.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2547  -16.4497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5469  -16.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9623  -16.8585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7868  -12.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4922  -13.1723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1987  -12.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1975  -11.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4840  -11.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7805  -11.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
  6  7  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 10 16  1  0
 16 17  1  0
  8 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
  3 22  1  0
 22 23  1  0
 22 24  1  0
 21 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5090710

    ---

Associated Targets(Human)

HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-HEP1 (1155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TARBP2 Tchem TAR RNA binding protein 2 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.47Molecular Weight (Monoisotopic): 404.1736AlogP: 4.09#Rotatable Bonds: 6
Polar Surface Area: 60.03Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.38CX LogP: 3.99CX LogD: 3.99
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -0.39

References

1. Zhou Z, Li Y, Ma X, Cao B, Peng T, Sheng Y, Peng H, Li R, Cao Y, Xi R, Li F, Wang M, Sun H, Zhang G, Zhang H, Hu K, Xiao W, Wang F..  (2021)  Identification of a Novel TAR RNA-Binding Protein 2 Modulator with Potential Therapeutic Activity against Hepatocellular Carcinoma.,  64  (11.0): [PMID:34038111] [10.1021/acs.jmedchem.1c00018]

Source