The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[N-[2-(1,3-benzoxazol-2-ylamino)-4-(4-chloro-1-methyl-pyrazol-3-yl)-6-methyl-1,4-dihydropyrimidine-5-carbonyl]carbamimidoyl]benzenecarboximidothioate ID: ALA5090755
PubChem CID: 140958063
Max Phase: Preclinical
Molecular Formula: C25H22ClN9O2S
Molecular Weight: 548.03
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)NC(=N)SC(=N)c2ccccc2)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C25H22ClN9O2S/c1-13-18(22(36)32-23(28)38-21(27)14-8-4-3-5-9-14)20(19-15(26)12-35(2)34-19)31-24(29-13)33-25-30-16-10-6-7-11-17(16)37-25/h3-12,20,27H,1-2H3,(H2,28,32,36)(H2,29,30,31,33)
Standard InChI Key: GQKNXNJWQAGRAC-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-1.2769 1.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2769 2.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1519 2.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5624 2.5979 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1519 1.3604 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5624 0.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8666 2.5980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5813 2.1854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3348 2.5209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8868 1.9079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4744 1.1935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6675 1.3651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1218 1.1930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7091 1.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7131 0.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8887 0.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9916 0.9478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7063 1.3604 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9916 0.1226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5624 0.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9916 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7451 2.2626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2971 2.8755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8847 3.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0778 3.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4946 4.0015 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.1218 2.8755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7063 -0.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7063 -1.1152 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.4210 0.1226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9916 -1.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2769 -1.1152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9916 -2.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2770 -2.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2778 -3.5887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9927 -4.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7046 -3.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7094 -2.7675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 4 2 0
2 4 1 0
5 3 1 0
6 5 1 0
1 6 2 0
3 7 1 0
7 8 1 0
9 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 2 0
13 14 2 0
10 14 1 0
15 13 1 0
16 15 2 0
11 16 1 0
1 17 1 0
17 18 2 0
17 19 1 0
6 20 1 0
21 2 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
25 26 1 0
23 27 1 0
19 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 2 0
31 33 1 0
34 33 2 0
35 34 1 0
36 35 2 0
37 36 1 0
38 37 2 0
33 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.03Molecular Weight (Monoisotopic): 547.1306AlogP: 4.41#Rotatable Bonds: 4Polar Surface Area: 157.07Molecular Species: NEUTRALHBA: 11HBD: 5#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.96CX Basic pKa: 5.68CX LogP: 4.25CX LogD: 4.25Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -0.92
References 1. (2019) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,