The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(7-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-5-ylamino)ethyl)-N-(2-aminophenyl)benzamide ID: ALA5090973
PubChem CID: 166633335
Max Phase: Preclinical
Molecular Formula: C23H21N9O2
Molecular Weight: 455.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccccc1NC(=O)c1ccc(CCNc2nc(N)n3nc(-c4ccco4)nc3n2)cc1
Standard InChI: InChI=1S/C23H21N9O2/c24-16-4-1-2-5-17(16)27-20(33)15-9-7-14(8-10-15)11-12-26-22-29-21(25)32-23(30-22)28-19(31-32)18-6-3-13-34-18/h1-10,13H,11-12,24H2,(H,27,33)(H3,25,26,28,29,30,31)
Standard InChI Key: AUEMIAAGFHBEHB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
37.0951 -10.0306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0951 -10.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8004 -11.2523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8004 -9.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5057 -10.0306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5056 -10.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2795 -11.0958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7579 -10.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2796 -9.7793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8004 -8.8007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.5731 -10.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0534 -11.0991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8306 -10.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8306 -10.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0534 -9.7770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.3880 -11.2575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6797 -10.8499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9726 -11.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2643 -10.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2659 -10.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5584 -9.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8503 -10.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8542 -10.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5622 -11.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1415 -9.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1392 -8.8135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4349 -10.0413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7261 -9.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7254 -8.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0174 -8.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3099 -8.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3148 -9.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0234 -10.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0287 -10.8636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 1 0
8 11 1 0
2 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.48Molecular Weight (Monoisotopic): 455.1818AlogP: 2.85#Rotatable Bonds: 7Polar Surface Area: 162.28Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.29CX LogP: 3.48CX LogD: 3.48Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.27Np Likeness Score: -1.65
References 1. Yan W, Ling L, Wu Y, Yang K, Liu R, Zhang J, Zhao S, Zhong G, Zhao S, Jiang H, Xie C, Cheng J.. (2021) Structure-Based Design of Dual-Acting Compounds Targeting Adenosine A2A Receptor and Histone Deacetylase as Novel Tumor Immunotherapeutic Agents., 64 (22.0): [PMID:34783558 ] [10.1021/acs.jmedchem.1c01155 ]