3-amino-1-(3-(cyclohexylmethoxy)-4-fluorophenyl)propan-1-ol

ID: ALA5091011

PubChem CID: 164603688

Max Phase: Preclinical

Molecular Formula: C16H24FNO2

Molecular Weight: 281.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCCC(O)c1ccc(F)c(OCC2CCCCC2)c1

Standard InChI:  InChI=1S/C16H24FNO2/c17-14-7-6-13(15(19)8-9-18)10-16(14)20-11-12-4-2-1-3-5-12/h6-7,10,12,15,19H,1-5,8-9,11,18H2

Standard InChI Key:  CYDVSJHNBXQOGZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   21.1748  -17.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6025  -16.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6014  -16.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3162  -17.3150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0326  -16.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0298  -16.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3143  -15.6620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8866  -17.3141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1725  -16.9010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4576  -17.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7435  -16.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4570  -18.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7423  -18.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0287  -17.3118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7477  -17.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7490  -18.1380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4615  -16.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8905  -16.8972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0281  -18.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8880  -15.6625    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  3  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 13 19  1  0
 11 14  1  0
  5 15  1  0
 15 16  1  0
 15 17  1  0
 17  1  1  0
  1 18  1  0
 14 19  1  0
  2 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5091011

    ---

Associated Targets(non-human)

RPE65 Retinoid isomerohydrolase (75 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 281.37Molecular Weight (Monoisotopic): 281.1791AlogP: 3.17#Rotatable Bonds: 6
Polar Surface Area: 55.48Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.67CX LogP: 2.63CX LogD: 0.43
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.84Np Likeness Score: -0.38

References

1. Blum E, Zhang J, Zaluski J, Einstein DE, Korshin EE, Kubas A, Gruzman A, Tochtrop GP, Kiser PD, Palczewski K..  (2021)  Rational Alteration of Pharmacokinetics of Chiral Fluorinated and Deuterated Derivatives of Emixustat for Retinal Therapy.,  64  (12.0): [PMID:34081480] [10.1021/acs.jmedchem.1c00279]

Source