The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(2-amino-2-oxoethyl)-2-(3,3-diphenylacrylamido)-5-guanidinopentanamide ID: ALA5091013
PubChem CID: 166635074
Max Phase: Preclinical
Molecular Formula: C23H28N6O3
Molecular Weight: 436.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H](NC(=O)C=C(c1ccccc1)c1ccccc1)C(=O)NCC(N)=O
Standard InChI: InChI=1S/C23H28N6O3/c24-20(30)15-28-22(32)19(12-7-13-27-23(25)26)29-21(31)14-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,14,19H,7,12-13,15H2,(H2,24,30)(H,28,32)(H,29,31)(H4,25,26,27)/t19-/m1/s1
Standard InChI Key: LCMPJODVRWZXLL-LJQANCHMSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
25.8061 -26.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8050 -27.3287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5130 -27.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2227 -27.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2199 -26.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5113 -26.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9260 -26.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6353 -26.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3414 -26.0890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3384 -25.2718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0507 -26.4949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7569 -26.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4661 -26.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1723 -26.0783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.7538 -25.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4599 -24.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4569 -24.0380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1630 -23.6267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1599 -22.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8661 -22.3983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.4507 -22.4036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8815 -26.4842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4692 -27.3067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5877 -26.0730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5846 -25.2558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2969 -26.4789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9231 -25.2813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6309 -24.8706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6281 -24.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9184 -23.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2099 -24.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2161 -24.8782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 6
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
14 22 1 0
13 23 2 0
22 24 1 0
24 25 2 0
24 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
7 27 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.52Molecular Weight (Monoisotopic): 436.2223AlogP: 0.47#Rotatable Bonds: 11Polar Surface Area: 163.19Molecular Species: BASEHBA: 4HBD: 6#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.59CX Basic pKa: 11.90CX LogP: -0.11CX LogD: -2.20Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.13Np Likeness Score: -0.12
References 1. Quillet R, Schneider S, Utard V, Drieu la Rochelle A, Elhabazi K, Henningsen JB, Gizzi P, Schmitt M, Kugler V, Simonneaux V, Ilien B, Simonin F, Bihel F.. (2021) Identification of an N -acylated-D Arg-Leu-NH2 Dipeptide as a Highly Selective Neuropeptide FF1 Receptor Antagonist That Potently Prevents Opioid-Induced Hyperalgesia., 64 (11.0): [PMID:34008968 ] [10.1021/acs.jmedchem.1c00256 ]