3-(3-methoxyphenyl)-N-(2-morpholinopyrimidin-4-yl)isoxazol-5-amine

ID: ALA5091202

PubChem CID: 156368915

Max Phase: Preclinical

Molecular Formula: C18H19N5O3

Molecular Weight: 353.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(-c2cc(Nc3ccnc(N4CCOCC4)n3)on2)c1

Standard InChI:  InChI=1S/C18H19N5O3/c1-24-14-4-2-3-13(11-14)15-12-17(26-22-15)20-16-5-6-19-18(21-16)23-7-9-25-10-8-23/h2-6,11-12H,7-10H2,1H3,(H,19,20,21)

Standard InChI Key:  BHXGJHKIBPEBEN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    6.7171   -5.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7711   -4.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1324   -3.4050    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3017   -3.4050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6631   -4.5172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7928   -4.8199    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6198   -3.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3174   -2.8631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1426   -2.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2727   -2.3421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5760   -3.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7543   -4.2969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7057   -3.7683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5327   -2.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6623   -3.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9650   -4.3737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1381   -5.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0084   -4.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6414   -4.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3383   -5.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2118   -6.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3845   -5.4231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6836   -4.2984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8108   -3.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8566   -3.4714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7269   -3.7741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  5  6  1  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
  7 12  1  0
 13 11  1  0
 13 14  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 13 18  1  0
 19  2  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 23 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5091202

    ---

Associated Targets(Human)

JIMT-1 (237 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 353.38Molecular Weight (Monoisotopic): 353.1488AlogP: 2.72#Rotatable Bonds: 5
Polar Surface Area: 85.54Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.62CX Basic pKa: 5.70CX LogP: 2.98CX LogD: 2.95
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.75Np Likeness Score: -1.91

References

1.  (2021)  Isoxazole derivatives targeting tacc3 as anticancer agents, 

Source