N-[[(3S)-1,1-dioxothian-3-yl]methyl]-1-(8-quinolyl)methanamine

ID: ALA5091270

PubChem CID: 166631757

Max Phase: Preclinical

Molecular Formula: C16H20N2O2S

Molecular Weight: 304.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S1(=O)CCC[C@@H](CNCc2cccc3cccnc23)C1

Standard InChI:  InChI=1S/C16H20N2O2S/c19-21(20)9-3-4-13(12-21)10-17-11-15-6-1-5-14-7-2-8-18-16(14)15/h1-2,5-8,13,17H,3-4,9-12H2/t13-/m0/s1

Standard InChI Key:  QMYKPSLMVJDZKJ-ZDUSSCGKSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   -1.7840    1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986    0.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0720    0.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0720   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7822   -0.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4986   -0.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2130   -0.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2032   -1.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7779   -1.4393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4896   -1.8560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3579   -0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3562   -0.2056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0704   -0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846    0.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4988    1.0313    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.2129    0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2130   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4988   -0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4988    1.8560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7846    1.4437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  2  6  1  0
  6  7  1  0
  8  7  2  0
  5  9  1  0
 10  9  2  0
 10  8  1  0
  4 11  1  0
 11 12  1  0
 12 13  1  0
 14 13  1  1
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 14 19  1  0
 16 20  2  0
 16 21  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5091270

    ---

Associated Targets(Human)

HTR5A Tchem Serotonin 5a (5-HT5a) receptor (1433 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 304.42Molecular Weight (Monoisotopic): 304.1245AlogP: 2.15#Rotatable Bonds: 4
Polar Surface Area: 59.06Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.83CX LogP: 1.03CX LogD: -0.41
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.94Np Likeness Score: -1.46

References

1. Levit Kaplan A, Strachan RT, Braz JM, Craik V, Slocum S, Mangano T, Amabo V, O'Donnell H, Lak P, Basbaum AI, Roth BL, Shoichet BK..  (2022)  Structure-Based Design of a Chemical Probe Set for the 5-HT5A Serotonin Receptor.,  65  (5.0): [PMID:35195401] [10.1021/acs.jmedchem.1c02031]

Source