The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-methoxyphenyl)-3-((1S)-(6-methoxyquinolin-4-yl)((2S)-8-vinylquinuclidin-2-yl)methyl)urea ID: ALA5091354
PubChem CID: 166633731
Max Phase: Preclinical
Molecular Formula: C28H32N4O3
Molecular Weight: 472.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC1CN2CCC1C[C@H]2[C@@H](NC(=O)Nc1ccc(OC)cc1)c1ccnc2ccc(OC)cc12
Standard InChI: InChI=1S/C28H32N4O3/c1-4-18-17-32-14-12-19(18)15-26(32)27(31-28(33)30-20-5-7-21(34-2)8-6-20)23-11-13-29-25-10-9-22(35-3)16-24(23)25/h4-11,13,16,18-19,26-27H,1,12,14-15,17H2,2-3H3,(H2,30,31,33)/t18?,19?,26-,27-/m0/s1
Standard InChI Key: JELXXKILZYJQJI-BOOWZDDJSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
6.7101 -23.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9925 -23.5052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0048 -23.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1866 -23.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6617 -22.5524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1762 -22.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4471 -23.1928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1765 -22.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3701 -23.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3726 -24.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7832 -23.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0760 -23.3540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7834 -24.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0776 -24.9786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0751 -25.7857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7816 -26.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4864 -25.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4833 -24.9783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0723 -22.5404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3647 -22.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1883 -24.5733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8925 -24.9755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4766 -21.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2849 -21.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8963 -25.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6059 -26.1980 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1905 -26.2046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3117 -25.7861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0168 -26.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7221 -25.7836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7188 -24.9655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0042 -24.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3018 -24.9739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4739 -24.2516 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.4240 -24.5527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1342 -24.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
2 5 1 0
3 6 1 0
4 7 1 0
5 8 1 0
6 7 1 0
6 8 1 0
9 10 2 0
10 14 1 0
13 11 1 0
11 12 2 0
12 9 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 13 2 0
12 19 1 0
19 20 1 0
18 21 1 0
21 22 1 1
21 4 1 0
8 23 1 0
23 24 2 0
22 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
4 34 1 1
31 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.59Molecular Weight (Monoisotopic): 472.2474AlogP: 5.01#Rotatable Bonds: 7Polar Surface Area: 75.72Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.47CX LogP: 3.98CX LogD: 2.87Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.47Np Likeness Score: -0.23
References 1. Jin PR, Ta YN, Chen IT, Yu YN, Hsieh HT, Nguyen VT, Hsieh SY, Hsia T, Liu H, Hsu CW, Han JL, Chen Y.. (2021) Cinchona Alkaloid-Inspired Urea-Containing Autophagy Inhibitor Shows Single-Agent Anticancer Efficacy., 64 (19.0): [PMID:34558909 ] [10.1021/acs.jmedchem.1c01036 ]