(1s,4s)-4-(6-amino-2-(pyridin-3-ylamino)-9H-purin-9-yl)-N-(3-methoxyphenyl)cyclohexanecarboxamide

ID: ALA5091366

PubChem CID: 134214760

Max Phase: Preclinical

Molecular Formula: C24H26N8O2

Molecular Weight: 458.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(NC(=O)[C@H]2CC[C@@H](n3cnc4c(N)nc(Nc5cccnc5)nc43)CC2)c1

Standard InChI:  InChI=1S/C24H26N8O2/c1-34-19-6-2-4-16(12-19)28-23(33)15-7-9-18(10-8-15)32-14-27-20-21(25)30-24(31-22(20)32)29-17-5-3-11-26-13-17/h2-6,11-15,18H,7-10H2,1H3,(H,28,33)(H3,25,29,30,31)/t15-,18+

Standard InChI Key:  QQQDPDYWXPNIQA-RHNCMZPLSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   29.2618   -3.6883    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9714   -3.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9686   -2.4562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2600   -2.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5537   -3.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5549   -2.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7788   -2.2093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.2978   -2.8692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7768   -3.5304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2562   -1.2337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5231   -4.3072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7243   -4.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4699   -5.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0129   -5.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8138   -5.6877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0717   -4.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7563   -6.6306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9561   -6.7963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4125   -6.1861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2999   -7.2407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6720   -5.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1291   -4.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3279   -4.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0725   -5.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6171   -6.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2729   -5.9186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7271   -5.3104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6798   -3.6863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6811   -4.5035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9727   -4.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9736   -5.7281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6825   -6.1364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3919   -5.7223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3875   -4.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  4 10  1  0
 11  9  1  1
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  1
 17 18  1  0
 18 19  1  0
 17 20  2  0
 19 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 19  1  0
 24 26  1  0
 26 27  1  0
  2 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5091366

    ---

Associated Targets(Human)

CHKA Tchem Choline kinase alpha (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.53Molecular Weight (Monoisotopic): 458.2179AlogP: 3.93#Rotatable Bonds: 6
Polar Surface Area: 132.87Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.91CX Basic pKa: 5.27CX LogP: 2.89CX LogD: 2.89
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.41

References

1. Quartieri F, Nesi M, Avanzi NR, Borghi D, Casale E, Corti E, Cucchi U, Donati D, Fasolini M, Felder ER, Galvani A, Giorgini ML, Lomolino A, Menichincheri M, Orrenius C, Perrera C, Re Depaolini S, Riccardi-Sirtori F, Salsi E, Isacchi A, Gnocchi P..  (2021)  Identification of unprecedented ATP-competitive choline kinase inhibitors.,  51  [PMID:34416377] [10.1016/j.bmcl.2021.128310]

Source