The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1s,4s)-4-(6-amino-2-(pyridin-3-ylamino)-9H-purin-9-yl)-N-(3-methoxyphenyl)cyclohexanecarboxamide ID: ALA5091366
PubChem CID: 134214760
Max Phase: Preclinical
Molecular Formula: C24H26N8O2
Molecular Weight: 458.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(NC(=O)[C@H]2CC[C@@H](n3cnc4c(N)nc(Nc5cccnc5)nc43)CC2)c1
Standard InChI: InChI=1S/C24H26N8O2/c1-34-19-6-2-4-16(12-19)28-23(33)15-7-9-18(10-8-15)32-14-27-20-21(25)30-24(31-22(20)32)29-17-5-3-11-26-13-17/h2-6,11-15,18H,7-10H2,1H3,(H,28,33)(H3,25,29,30,31)/t15-,18+
Standard InChI Key: QQQDPDYWXPNIQA-RHNCMZPLSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
29.2618 -3.6883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9714 -3.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9686 -2.4562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2600 -2.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5537 -3.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5549 -2.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7788 -2.2093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2978 -2.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7768 -3.5304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.2562 -1.2337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5231 -4.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7243 -4.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4699 -5.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0129 -5.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8138 -5.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0717 -4.9095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7563 -6.6306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9561 -6.7963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4125 -6.1861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2999 -7.2407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.6720 -5.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1291 -4.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3279 -4.9694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0725 -5.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6171 -6.3566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2729 -5.9186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7271 -5.3104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6798 -3.6863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6811 -4.5035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9727 -4.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9736 -5.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6825 -6.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3919 -5.7223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3875 -4.9072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
4 10 1 0
11 9 1 1
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
14 17 1 1
17 18 1 0
18 19 1 0
17 20 2 0
19 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 19 1 0
24 26 1 0
26 27 1 0
2 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.53Molecular Weight (Monoisotopic): 458.2179AlogP: 3.93#Rotatable Bonds: 6Polar Surface Area: 132.87Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.91CX Basic pKa: 5.27CX LogP: 2.89CX LogD: 2.89Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.41
References 1. Quartieri F, Nesi M, Avanzi NR, Borghi D, Casale E, Corti E, Cucchi U, Donati D, Fasolini M, Felder ER, Galvani A, Giorgini ML, Lomolino A, Menichincheri M, Orrenius C, Perrera C, Re Depaolini S, Riccardi-Sirtori F, Salsi E, Isacchi A, Gnocchi P.. (2021) Identification of unprecedented ATP-competitive choline kinase inhibitors., 51 [PMID:34416377 ] [10.1016/j.bmcl.2021.128310 ]