The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Aspergillicin H ID: ALA5091413
PubChem CID: 166635445
Max Phase: Preclinical
Molecular Formula: C37H54N6O9
Molecular Weight: 726.87
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C[C@H]2C(=O)N[C@@H](C(C)C)C(=O)O[C@H](C)[C@H](NC(C)=O)C(=O)N[C@H](C(C)C)C(=O)N3CCC[C@H]3C(=O)N3CCC[C@H]3C(=O)N2C)cc1
Standard InChI: InChI=1S/C37H54N6O9/c1-20(2)29-36(49)43-18-10-12-27(43)35(48)42-17-9-11-26(42)34(47)41(7)28(19-24-13-15-25(51-8)16-14-24)32(45)40-30(21(3)4)37(50)52-22(5)31(33(46)39-29)38-23(6)44/h13-16,20-22,26-31H,9-12,17-19H2,1-8H3,(H,38,44)(H,39,46)(H,40,45)/t22-,26+,27+,28+,29-,30+,31+/m1/s1
Standard InChI Key: QDLQNCCOPGFZAQ-XIORJYECSA-N
Molfile:
RDKit 2D
54 57 0 0 0 0 0 0 0 0999 V2000
36.4580 -13.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2434 -12.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4275 -12.3120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1394 -13.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7748 -13.5859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1657 -13.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8651 -13.1411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5687 -13.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2764 -13.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5687 -14.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2764 -14.7672 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2764 -15.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9800 -15.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5687 -15.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5687 -16.7978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8651 -12.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8651 -14.7672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9800 -16.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6836 -15.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2764 -12.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1657 -14.3586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.7342 -14.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0112 -14.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4208 -14.8412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2884 -14.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7121 -14.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0851 -15.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8877 -15.5798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8651 -17.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1657 -16.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5932 -15.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5953 -16.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2999 -17.2005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5631 -17.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5949 -17.9823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1616 -12.7284 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
35.0030 -13.9500 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.0670 -18.6494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.9837 -11.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9841 -11.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2794 -10.7052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5729 -11.1161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5761 -11.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8881 -17.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1799 -16.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8892 -18.0204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8807 -18.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3527 -19.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2224 -17.8318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0855 -18.6413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2990 -15.5687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8619 -15.5746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2783 -9.8880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9855 -9.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 1 0
7 8 1 0
8 9 1 1
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 1
12 14 1 0
14 15 1 0
7 16 1 0
10 17 2 0
13 18 1 0
13 19 1 0
9 20 1 0
6 1 1 0
6 21 2 0
5 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 23 1 0
15 29 1 0
29 30 1 1
28 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
29 35 1 0
34 35 1 0
1 36 1 6
23 37 1 6
35 38 1 6
20 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 20 1 0
32 44 1 6
44 45 1 0
44 46 1 0
38 47 1 0
47 48 1 0
47 49 2 0
34 50 2 0
31 51 2 0
14 52 2 0
41 53 1 0
53 54 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 726.87Molecular Weight (Monoisotopic): 726.3952AlogP: 0.78#Rotatable Bonds: 6Polar Surface Area: 183.76Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 15HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.62CX Basic pKa: ┄CX LogP: 0.63CX LogD: 0.63Aromatic Rings: 1Heavy Atoms: 52QED Weighted: 0.36Np Likeness Score: 0.96
References 1. Wang X, Serrano R, González-Menéndez V, Mackenzie TA, Ramos MC, Frisvad JC, Larsen TO.. (2022) A Molecular Networking Based Discovery of Diketopiperazine Heterodimers and Aspergillicins from Aspergillus caelatus ., 85 (1.0): [PMID:35045259 ] [10.1021/acs.jnatprod.1c00526 ]