Methyl 6-[4-(Dimethylamino)phenyl]-2-methoxybenzo[d][1,3]dioxole-5-carboxylate

ID: ALA5091460

PubChem CID: 53245967

Max Phase: Preclinical

Molecular Formula: C18H19NO5

Molecular Weight: 329.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1cc2c(c(OC)c1-c1ccc(N(C)C)cc1)OCO2

Standard InChI:  InChI=1S/C18H19NO5/c1-19(2)12-7-5-11(6-8-12)15-13(18(20)22-4)9-14-16(17(15)21-3)24-10-23-14/h5-9H,10H2,1-4H3

Standard InChI Key:  BVAOVMDHWBCWPH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   29.1286   -4.9526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1274   -5.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8355   -6.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5451   -5.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5423   -4.9490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8337   -4.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8284   -3.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5365   -3.3193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5344   -2.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1217   -3.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1162   -2.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8240   -2.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6498   -1.2966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.8343   -1.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5045   -1.9651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4164   -3.7384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7063   -3.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2450   -3.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2466   -4.5437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9519   -3.3166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6605   -3.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8353   -6.9983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.1275   -7.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5429   -7.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
  6  7  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 10 16  1  0
 16 17  1  0
  8 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
  3 22  1  0
 22 23  1  0
 22 24  1  0
M  END

Associated Targets(Human)

SK-HEP1 (1155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 329.35Molecular Weight (Monoisotopic): 329.1263AlogP: 2.94#Rotatable Bonds: 4
Polar Surface Area: 57.23Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.33CX LogP: 3.20CX LogD: 3.20
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.80Np Likeness Score: 0.18

References

1. Zhou Z, Li Y, Ma X, Cao B, Peng T, Sheng Y, Peng H, Li R, Cao Y, Xi R, Li F, Wang M, Sun H, Zhang G, Zhang H, Hu K, Xiao W, Wang F..  (2021)  Identification of a Novel TAR RNA-Binding Protein 2 Modulator with Potential Therapeutic Activity against Hepatocellular Carcinoma.,  64  (11.0): [PMID:34038111] [10.1021/acs.jmedchem.1c00018]

Source