The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1s,4s)-4-(6-amino-2-chloro-9H-purin-9-yl)-N-(4-(trifluoromethylsulfonyl)phenyl)cyclohexanecarboxamide ID: ALA5091650
PubChem CID: 134214624
Max Phase: Preclinical
Molecular Formula: C19H18ClF3N6O3S
Molecular Weight: 502.91
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(Cl)nc2c1ncn2[C@H]1CC[C@@H](C(=O)Nc2ccc(S(=O)(=O)C(F)(F)F)cc2)CC1
Standard InChI: InChI=1S/C19H18ClF3N6O3S/c20-18-27-15(24)14-16(28-18)29(9-25-14)12-5-1-10(2-6-12)17(30)26-11-3-7-13(8-4-11)33(31,32)19(21,22)23/h3-4,7-10,12H,1-2,5-6H2,(H,26,30)(H2,24,27,28)/t10-,12+
Standard InChI Key: IWCNLFJSRUUYDE-KLPPZKSPSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
25.0891 -13.5890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3060 -14.3897 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.8908 -13.8016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8430 -13.7127 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5600 -13.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5572 -12.4679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8412 -12.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1277 -13.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1289 -12.4746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3447 -12.2185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8588 -12.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3427 -13.5532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8374 -11.2329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0865 -14.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2795 -14.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0224 -15.2840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5709 -15.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3802 -15.7327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6407 -14.9466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3117 -16.6853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5033 -16.8527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9541 -16.2362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8609 -17.3016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2162 -15.4559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6679 -14.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8584 -15.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6004 -15.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1505 -16.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5888 -14.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5814 -15.6239 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.8774 -14.3792 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.8716 -15.2069 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.2756 -13.7108 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
7 13 1 0
14 12 1 1
14 15 1 0
14 19 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
17 20 1 1
20 21 1 0
21 22 1 0
20 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 22 1 0
26 2 1 0
2 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
5 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.91Molecular Weight (Monoisotopic): 502.0802AlogP: 3.73#Rotatable Bonds: 4Polar Surface Area: 132.86Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.04CX Basic pKa: 2.03CX LogP: 4.01CX LogD: 4.01Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -1.33
References 1. Quartieri F, Nesi M, Avanzi NR, Borghi D, Casale E, Corti E, Cucchi U, Donati D, Fasolini M, Felder ER, Galvani A, Giorgini ML, Lomolino A, Menichincheri M, Orrenius C, Perrera C, Re Depaolini S, Riccardi-Sirtori F, Salsi E, Isacchi A, Gnocchi P.. (2021) Identification of unprecedented ATP-competitive choline kinase inhibitors., 51 [PMID:34416377 ] [10.1016/j.bmcl.2021.128310 ]