The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((R)-2-(3,3-diphenylacrylamido)-5-guanidinopentanamido)succinamide ID: ALA5091693
PubChem CID: 166635093
Max Phase: Preclinical
Molecular Formula: C25H31N7O4
Molecular Weight: 493.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H](NC(=O)C=C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](CC(N)=O)C(N)=O
Standard InChI: InChI=1S/C25H31N7O4/c26-21(33)15-20(23(27)35)32-24(36)19(12-7-13-30-25(28)29)31-22(34)14-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,14,19-20H,7,12-13,15H2,(H2,26,33)(H2,27,35)(H,31,34)(H,32,36)(H4,28,29,30)/t19-,20+/m1/s1
Standard InChI Key: JTXZBNPEBGYQTN-UXHICEINSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
37.4202 -15.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4190 -16.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1271 -16.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8367 -16.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8339 -15.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1253 -15.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5401 -15.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2493 -15.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9555 -15.0693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9524 -14.2521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.6647 -15.4752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.3709 -15.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0801 -15.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7863 -15.0586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.3678 -14.2467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0740 -13.8355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0709 -13.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7770 -12.6070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.7740 -11.7898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4801 -11.3786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.0647 -11.3839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.4955 -15.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0832 -16.2870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.2017 -15.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1986 -14.2361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.9109 -15.4592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.5371 -14.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2449 -13.8509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2422 -13.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5324 -12.6278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8239 -13.0434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8301 -13.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4986 -16.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2078 -16.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2109 -17.5048 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.9140 -16.2764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 1 6
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
14 22 1 0
13 23 2 0
22 24 1 0
24 25 2 0
24 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
7 27 1 0
22 33 1 6
33 34 1 0
34 35 2 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 493.57Molecular Weight (Monoisotopic): 493.2438AlogP: -0.29#Rotatable Bonds: 13Polar Surface Area: 206.28Molecular Species: BASEHBA: 5HBD: 7#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 10#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.24CX Basic pKa: 11.78CX LogP: -1.01CX LogD: -3.08Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.09Np Likeness Score: 0.10
References 1. Quillet R, Schneider S, Utard V, Drieu la Rochelle A, Elhabazi K, Henningsen JB, Gizzi P, Schmitt M, Kugler V, Simonneaux V, Ilien B, Simonin F, Bihel F.. (2021) Identification of an N -acylated-D Arg-Leu-NH2 Dipeptide as a Highly Selective Neuropeptide FF1 Receptor Antagonist That Potently Prevents Opioid-Induced Hyperalgesia., 64 (11.0): [PMID:34008968 ] [10.1021/acs.jmedchem.1c00256 ]