The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(6,7-Dichloro-9-(1-methyl-1H-pyrazol-3-yl)-1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)-2-oxoethyl)-2-(furan-2-yl)acetamide ID: ALA5092170
PubChem CID: 166632113
Max Phase: Preclinical
Molecular Formula: C23H21Cl2N5O3
Molecular Weight: 486.36
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1ccc(-c2cc(Cl)c(Cl)c3[nH]c4c(c23)CN(C(=O)CNC(=O)Cc2ccco2)CC4)n1
Standard InChI: InChI=1S/C23H21Cl2N5O3/c1-29-6-4-18(28-29)14-10-16(24)22(25)23-21(14)15-12-30(7-5-17(15)27-23)20(32)11-26-19(31)9-13-3-2-8-33-13/h2-4,6,8,10,27H,5,7,9,11-12H2,1H3,(H,26,31)
Standard InChI Key: AJZDPINAQHQTPL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
14.8195 -12.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8183 -13.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5305 -14.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5287 -12.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2414 -12.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2462 -13.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0304 -14.0270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0226 -12.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5105 -13.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3215 -13.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6509 -12.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1672 -11.8543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3499 -11.9430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1103 -14.1912 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.5315 -15.0134 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.5231 -11.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1869 -11.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9321 -10.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1107 -10.4675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8565 -11.2495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6242 -9.8037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4960 -11.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3124 -11.0126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0083 -10.4432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8000 -11.6755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6165 -11.5861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1000 -12.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9452 -10.8338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9164 -12.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4703 -12.7629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2194 -12.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1300 -11.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3257 -11.4445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
2 14 1 0
3 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 16 2 0
4 16 1 0
19 21 1 0
12 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.36Molecular Weight (Monoisotopic): 485.1021AlogP: 3.71#Rotatable Bonds: 5Polar Surface Area: 96.16Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.03CX Basic pKa: 1.95CX LogP: 2.43CX LogD: 2.43Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.74
References 1. Tan J, Wu B, Chen T, Fan C, Zhao J, Xiong C, Feng C, Xiao R, Ding C, Tang W, Zhang A.. (2021) Synthesis and Pharmacological Evaluation of Tetrahydro-γ-carboline Derivatives as Potent Anti-inflammatory Agents Targeting Cyclic GMP-AMP Synthase., 64 (11.0): [PMID:34044539 ] [10.1021/acs.jmedchem.1c00398 ]