5-[7-[1-(cyclopropylmethyl)pyrazol-4-yl]-1-fluoro-3-hydroxy-2-naphthyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one

ID: ALA5092308

PubChem CID: 153192059

Max Phase: Preclinical

Molecular Formula: C19H17FN4O4S

Molecular Weight: 416.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CN(c2c(O)cc3ccc(-c4cnn(CC5CC5)c4)cc3c2F)S(=O)(=O)N1

Standard InChI:  InChI=1S/C19H17FN4O4S/c20-18-15-5-12(14-7-21-23(9-14)8-11-1-2-11)3-4-13(15)6-16(25)19(18)24-10-17(26)22-29(24,27)28/h3-7,9,11,25H,1-2,8,10H2,(H,22,26)

Standard InChI Key:  WIFWJQAGHBRNHU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   40.4170   -2.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.2170   -2.5209    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   41.0047   -1.7197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5739   -3.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5728   -4.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2875   -5.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2857   -3.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0012   -3.7713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0019   -4.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7173   -5.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4322   -4.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4275   -3.7645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7116   -3.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1385   -3.3452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.8943   -3.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4426   -3.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0257   -2.3476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.2636   -3.1409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.7072   -2.5322    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   41.1483   -5.0041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.8638   -3.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7774   -2.5425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9704   -2.3712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5580   -3.0858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.1103   -3.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6346   -1.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8141   -1.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1489   -1.0460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0628   -1.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17  2  1  0
  2 14  1  0
 12 14  1  0
 16 18  2  0
 13 19  1  0
 11 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
  4 21  1  0
 23 26  1  0
 26 27  1  0
 28 27  1  0
 29 28  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5092308

    ---

Associated Targets(Human)

PTPN2 Tchem T-cell protein-tyrosine phosphatase (1317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN1 Tchem Protein-tyrosine phosphatase 1B (8528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

B16-F10 (4610 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.43Molecular Weight (Monoisotopic): 416.0955AlogP: 2.14#Rotatable Bonds: 4
Polar Surface Area: 104.53Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.77CX Basic pKa: 1.76CX LogP: 1.49CX LogD: 0.49
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: -0.79

References

1. Abdel-Magid AF..  (2022)  The Inhibitors of Protein Tyrosine Phosphatase Nonreceptor Type 2 (PTPN2) as Potential Enhancers of Cancer Immunotherapy and Type 1 (PTPN1) as Treatment of Metabolic Diseases.,  13  (1.0): [PMID:35059117] [10.1021/acsmedchemlett.1c00678]

Source