(S)-6-amino-2-((2S,5S,11S,14S,23S)-23-amino-11,14-dibenzyl-2-(3-guanidinopropyl)-24-(4-hydroxy-2,6-dimethylphenyl)-5-methyl-4,7,10,13,16,19,22-heptaoxo-3,6,9,12,15,18,21-heptaazatetracosanamido)-N-((S)-1-((S)-1-((S)-1-((S)-1,6-diamino-1-oxohexan-2-ylamino)-5-guanidino-1-oxopentan-2-ylamino)-1-oxopropan-2-ylamino)-3-hydroxy-1-oxopropan-2-yl)hexanamide

ID: ALA5092388

PubChem CID: 166631502

Max Phase: Preclinical

Molecular Formula: C68H106N22O15

Molecular Weight: 1471.74

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Bioactivity Summary Target Summary Assay Summary

Names and Identifiers

Canonical SMILES: Cc1cc(O)cc(C)c1C[C@H](N)C(=O)NCC(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(N)=O

Standard InChI: InChI=1S/C68H106N22O15/c1-38-29-44(92)30-39(2)45(38)33-46(71)60(99)80-34-54(93)79-35-56(95)84-52(32-43-19-9-6-10-20-43)65(104)89-51(31-42-17-7-5-8-18-42)61(100)81-36-55(94)82-40(3)58(97)86-50(24-16-28-78-68(75)76)63(102)88-48(22-12-14-26-70)64(103)90-53(37-91)66(105)83-41(4)59(98)87-49(23-15-27-77-67(73)74)62(101)85-47(57(72)96)21-11-13-25-69/h5-10,17-20,29-30,40-41,46-53,91-92H,11-16,21-28,31-37,69-71H2,1-4H3,(H2,72,96)(H,79,93)(H,80,99)(H,81,100)(H,82,94)(H,83,105)(H,84,95)(H,85,101)(H,86,97)(H,87,98)(H,88,102)(H,89,104)(H,90,103)(H4,73,74,77)(H4,75,76,78)/t40-,41-,46-,47-,48-,49-,50-,51-,52-,53-/m0/s1

Standard InChI Key: WZXCVLAHVDNGKO-VNUMKYHHSA-N

Molfile:

 
     RDKit          2D

105107  0  0  0  0  0  0  0  0999 V2000
   -6.6820   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9782   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2744   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3945   -4.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0988   -4.9202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0983   -5.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3913   -6.1467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6841   -5.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5623   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8585   -4.9238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1465   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4427   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7306   -4.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0268   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3147   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3951   -4.9238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1028   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8105   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5182   -4.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2259   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9336   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6414   -4.9238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3491   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0568   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7645   -4.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4722   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1799   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8876   -4.9238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5953   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3030   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0107   -4.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7184   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4261   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1338   -4.9238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8416   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2570   -4.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9647   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6724   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3801   -4.9238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0878   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7955   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5032   -4.5152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2109   -4.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9186   -4.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2744   -5.7410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5623   -3.6980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4427   -5.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3147   -3.6980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8105   -5.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1028   -3.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8105   -3.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5184   -3.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2257   -3.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2261   -2.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5134   -2.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8091   -2.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2259   -5.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9336   -6.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9336   -3.6980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0568   -5.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1799   -3.6980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3030   -5.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4261   -3.6980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493   -5.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6724   -3.6980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7955   -5.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4722   -5.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7184   -5.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9647   -5.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5953   -3.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8416   -3.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0878   -3.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2109   -5.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8876   -3.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8876   -2.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1799   -2.0636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1799   -1.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4722   -0.8378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.8876   -0.8378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4261   -6.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4261   -6.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1339   -7.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1339   -8.1925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5493   -3.2894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7955   -3.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7955   -2.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5032   -2.0636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5032   -1.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2109   -0.8378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7955   -0.8378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9186   -6.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9186   -6.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6264   -7.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6264   -8.1925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9186   -3.6980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6264   -4.9238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8109   -6.1478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9733   -6.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3878   -3.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9305   -6.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6374   -7.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3461   -6.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3434   -6.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6360   -5.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  1  1  0
  3  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 20 19  1  6
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 44 45  1  0
  3 46  1  1
  9 47  2  0
 12 48  2  0
 15 49  2  0
 18 50  2  0
 17 51  1  1
 51 52  1  0
 52 53  2  0
 53 54  1  0
 54 55  2  0
 55 56  1  0
 56 57  2  0
 57 52  1  0
 20 58  1  0
 58 59  1  0
 21 60  2  0
 24 61  2  0
 27 62  2  0
 30 63  2  0
 33 64  2  0
 36 65  2  0
 39 66  2  0
 42 67  2  0
 26 68  1  6
 32 69  1  6
 38 70  1  6
 29 71  1  1
 35 72  1  1
 41 73  1  1
 44 74  1  6
 71 75  1  0
 75 76  1  0
 76 77  1  0
 77 78  1  0
 78 79  1  0
 78 80  2  0
 69 81  1  0
 81 82  1  0
 82 83  1  0
 83 84  1  0
 72 85  1  0
 73 86  1  0
 86 87  1  0
 87 88  1  0
 88 89  1  0
 89 90  1  0
 89 91  2  0
 74 92  1  0
 92 93  1  0
 93 94  1  0
 94 95  1  0
 45 96  2  0
 45 97  1  0
  6 98  1  0
  8 99  1  0
  4100  1  0
 59101  2  0
101102  1  0
102103  2  0
103104  1  0
104105  2  0
105 59  1  0
M  END

Associated Targets(Human)

OPRL1 Tchem Nociceptin receptor (3823 Activities)

Discover Target: OPRL1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

OPRM1 Tclin Mu opioid receptor (19785 Activities)

Discover Target: OPRM1

Activity Type	Relation	Activity value	Units	Action Type	Journal	PubMed Id	doi	Assay Aladdin ID

Natural Product: No	Oral: No	Chemical Probe: No	Parenteral: No
Molecule Type: Unknown	Topical: No	First In Class: No	Black Box: No
Chirality: No	Availability: No	Prodrug: No

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 1471.74	Molecular Weight (Monoisotopic): 1470.8208	AlogP: ┄	#Rotatable Bonds: ┄
Polar Surface Area: ┄	Molecular Species: ┄	HBA: ┄	HBD: ┄
#RO5 Violations: ┄	HBA (Lipinski): ┄	HBD (Lipinski): ┄	#RO5 Violations (Lipinski): ┄
CX Acidic pKa: ┄	CX Basic pKa: ┄	CX LogP: ┄	CX LogD: ┄
Aromatic Rings: ┄	Heavy Atoms: ┄	QED Weighted: ┄	Np Likeness Score: ┄

References

1. Pacifico S, Albanese V, Illuminati D, Marzola E, Fabbri M, Ferrari F, Holanda VAD, Sturaro C, Malfacini D, Ruzza C, Trapella C, Preti D, Lo Cascio E, Arcovito A, Della Longa S, Marangoni M, Fattori D, Nassini R, Calò G, Guerrini R.. (2021) Novel Mixed NOP/Opioid Receptor Peptide Agonists., 64 (10.0): [PMID:33998786] [10.1021/acs.jmedchem.0c02062]
2. Ghirmai, Senait; Azar, Marc R and Cashman, John R. 2009-09-15 Synthesis and pharmacological evaluation of 6-naltrexamine analogs for alcohol cessation. [PMID:19683449]
3. Toll, Lawrence L and 5 more authors. 2009-12 Comparison of the antinociceptive and antirewarding profiles of novel bifunctional nociceptin receptor/mu-opioid receptor ligands: implications for therapeutic applications. [PMID:19773529]
4. McLeod, Robbie L and 20 more authors. 2010-03-25 Pharmacological profile of the NOP agonist and cough suppressing agent SCH 486757 (8-[Bis(2-Chlorophenyl)Methyl]-3-(2-Pyrimidinyl)-8-Azabicyclo[3.2.1]Octan-3-Ol) in preclinical models. [PMID:20006596]
5. Pike, Victor W and 14 more authors. 2011-04-28 Synthesis and evaluation of radioligands for imaging brain nociceptin/orphanin FQ peptide (NOP) receptors with positron emission tomography. [PMID:21438532]
6. Cami-Kobeci, Gerta; Polgar, Willma E; Khroyan, Taline V; Toll, Lawrence and Husbands, Stephen M. 2011-10-13 Structural determinants of opioid and NOP receptor activity in derivatives of buprenorphine. [PMID:21866885]
7. Zaveri, Nurulain T; Jiang, Faming; Olsen, Cris; Polgar, Willma E and Toll, Lawrence. 2013-06-01 Designing bifunctional NOP receptor-mu opioid receptor ligands from NOP receptor-selective scaffolds. Part I. [PMID:23623415]
8. Journigan, V Blair VB, Polgar, Willma E WE, Khroyan, Taline V TV and Zaveri, Nurulain T NT. 2014-04-15 Designing bifunctional NOP receptor-mu opioid receptor ligands from NOP-receptor selective scaffolds. Part II. [PMID:24657054]
9. Linz, Klaus K and 13 more authors. 2014-06 Cebranopadol: a novel potent analgesic nociceptin/orphanin FQ peptide and opioid receptor agonist. [PMID:24713140]
10. Kumar, Vinod and 10 more authors. 2014-05-22 Selectively promiscuous opioid ligands: discovery of high affinity/low efficacy opioid ligands with substantial nociceptin opioid peptide receptor affinity. [PMID:24761755]
11. Cueva, Juan Pablo and 8 more authors. 2015-05-28 C7β-methyl analogues of the orvinols: the discovery of kappa opioid antagonists with nociceptin/orphanin FQ peptide (NOP) receptor partial agonism and low, or zero, efficacy at mu opioid receptors. [PMID:25898137]
12. and Zaveri, Nurulain T NT. 2016-08-11 Nociceptin Opioid Receptor (NOP) as a Therapeutic Target: Progress in Translation from Preclinical Research to Clinical Utility. [PMID:26878436]
13. Guillemyn, Karel and 18 more authors. 2016-04-28 Bifunctional Peptide-Based Opioid Agonist-Nociceptin Antagonist Ligands for Dual Treatment of Acute and Neuropathic Pain. [PMID:27035422]
14. Arcuri, Ludovico L and 12 more authors. 2018-03 Anti-Parkinsonian and anti-dyskinetic profiles of two novel potent and selective nociceptin/orphanin FQ receptor agonists. [PMID:29232769]
15. Gege, Christian and 15 more authors. 2018-05-15 Identification and biological evaluation of thiazole-based inverse agonists of RORγt. [PMID:29631962]
16. Kamakolanu, Uma Gayathri and 9 more authors. 2020-03-12 Discovery and Structure-Activity Relationships of Nociceptin Receptor Partial Agonists That Afford Symptom Ablation in Parkinson's Disease Models. [PMID:31951130]

Names and Identifiers

Alternative Forms

Associated Targets(Human)

Molecule Features

Drug Indications

Mechanisms of Action

Calculated Properties

References

Source