The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4'-(ethane-1,2-diylbis(oxy))bis(benzene-4,2,1-triyl) tetrakis(dihydrogen phosphate) ID: ALA5092487
PubChem CID: 166633759
Max Phase: Preclinical
Molecular Formula: C14H18O18P4
Molecular Weight: 598.18
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)Oc1ccc(OCCOc2ccc(OP(=O)(O)O)c(OP(=O)(O)O)c2)cc1OP(=O)(O)O
Standard InChI: InChI=1S/C14H18O18P4/c15-33(16,17)29-11-3-1-9(7-13(11)31-35(21,22)23)27-5-6-28-10-2-4-12(30-34(18,19)20)14(8-10)32-36(24,25)26/h1-4,7-8H,5-6H2,(H2,15,16,17)(H2,18,19,20)(H2,21,22,23)(H2,24,25,26)
Standard InChI Key: RTQLGGKEKRUTOS-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
18.9261 -13.8881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9249 -14.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6330 -15.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3426 -14.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3398 -13.8845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6312 -13.4792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6328 -15.9338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0459 -13.4732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7552 -13.8792 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
22.4614 -13.4679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7583 -14.6963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7505 -13.0586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6287 -12.6620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9198 -12.2556 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
18.9174 -11.4384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2133 -12.6663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9151 -13.0709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9249 -16.3422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9247 -17.1594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2169 -17.5678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2167 -18.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5091 -18.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5085 -19.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2167 -20.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9268 -19.6044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9239 -18.7893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8005 -20.0157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0931 -19.6065 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
15.3851 -20.0146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0937 -18.7894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0879 -20.4215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2176 -20.8344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9257 -21.2422 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
18.9266 -22.0594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6330 -20.8328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9192 -20.4215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
9 12 1 0
6 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 2 0
7 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
23 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
28 31 2 0
24 32 1 0
32 33 1 0
33 34 1 0
33 35 1 0
33 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 598.18Molecular Weight (Monoisotopic): 597.9444AlogP: 1.03#Rotatable Bonds: 13Polar Surface Area: 285.50Molecular Species: ACIDHBA: 10HBD: 8#RO5 Violations: 2HBA (Lipinski): 18HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.11CX Basic pKa: ┄CX LogP: -0.37CX LogD: -12.99Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: 0.15
References 1. Whitfield H, Hemmings AM, Mills SJ, Baker K, White G, Rushworth S, Riley AM, Potter BVL, Brearley CA.. (2021) Allosteric Site on SHIP2 Identified Through Fluorescent Ligand Screening and Crystallography: A Potential New Target for Intervention., 64 (7.0): [PMID:33724834 ] [10.1021/acs.jmedchem.0c01944 ]