4,4'-(ethane-1,2-diylbis(oxy))bis(benzene-4,2,1-triyl) tetrakis(dihydrogen phosphate)

ID: ALA5092487

PubChem CID: 166633759

Max Phase: Preclinical

Molecular Formula: C14H18O18P4

Molecular Weight: 598.18

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=P(O)(O)Oc1ccc(OCCOc2ccc(OP(=O)(O)O)c(OP(=O)(O)O)c2)cc1OP(=O)(O)O

Standard InChI:  InChI=1S/C14H18O18P4/c15-33(16,17)29-11-3-1-9(7-13(11)31-35(21,22)23)27-5-6-28-10-2-4-12(30-34(18,19)20)14(8-10)32-36(24,25)26/h1-4,7-8H,5-6H2,(H2,15,16,17)(H2,18,19,20)(H2,21,22,23)(H2,24,25,26)

Standard InChI Key:  RTQLGGKEKRUTOS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
   18.9261  -13.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9249  -14.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6330  -15.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3426  -14.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3398  -13.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6312  -13.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6328  -15.9338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0459  -13.4732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7552  -13.8792    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   22.4614  -13.4679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7583  -14.6963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7505  -13.0586    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6287  -12.6620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9198  -12.2556    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   18.9174  -11.4384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2133  -12.6663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9151  -13.0709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9249  -16.3422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9247  -17.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2169  -17.5678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2167  -18.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5091  -18.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5085  -19.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2167  -20.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9268  -19.6044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9239  -18.7893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8005  -20.0157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0931  -19.6065    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   15.3851  -20.0146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0937  -18.7894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0879  -20.4215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2176  -20.8344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9257  -21.2422    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   18.9266  -22.0594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6330  -20.8328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9192  -20.4215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
  9 12  1  0
  6 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  2  0
  7 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 23 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 28 31  2  0
 24 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 33 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5092487

    ---

Associated Targets(Human)

INPPL1 Tchem Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 (180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 598.18Molecular Weight (Monoisotopic): 597.9444AlogP: 1.03#Rotatable Bonds: 13
Polar Surface Area: 285.50Molecular Species: ACIDHBA: 10HBD: 8
#RO5 Violations: 2HBA (Lipinski): 18HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 1.11CX Basic pKa: CX LogP: -0.37CX LogD: -12.99
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.12Np Likeness Score: 0.15

References

1. Whitfield H, Hemmings AM, Mills SJ, Baker K, White G, Rushworth S, Riley AM, Potter BVL, Brearley CA..  (2021)  Allosteric Site on SHIP2 Identified Through Fluorescent Ligand Screening and Crystallography: A Potential New Target for Intervention.,  64  (7.0): [PMID:33724834] [10.1021/acs.jmedchem.0c01944]

Source