N-(2'-Methyl-5'-fluorophenyl)-3-alpha,7-beta-dihydroxy-5-beta-cholan-24-amide

ID: ALA5092542

PubChem CID: 166634731

Max Phase: Preclinical

Molecular Formula: C31H46FNO3

Molecular Weight: 499.71

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(F)cc1NC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C31H46FNO3/c1-18(6-10-28(36)33-26-17-21(32)7-5-19(26)2)23-8-9-24-29-25(12-14-31(23,24)4)30(3)13-11-22(34)15-20(30)16-27(29)35/h5,7,17-18,20,22-25,27,29,34-35H,6,8-16H2,1-4H3,(H,33,36)/t18-,20+,22-,23-,24+,25+,27+,29+,30+,31-/m1/s1

Standard InChI Key:  SGQIHGBJYFYCPM-PGGCCGQUSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   21.2552   -7.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4363   -6.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4363   -7.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1416   -7.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1416   -5.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8469   -6.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8434   -7.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5455   -7.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5524   -6.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2590   -6.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2759   -4.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5577   -5.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9825   -5.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9692   -6.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7437   -6.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2357   -5.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7652   -4.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8355   -8.0398    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.8396   -5.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5453   -6.8182    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.2511   -5.6006    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   21.9775   -4.3790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9610   -6.8347    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.1661   -4.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9833   -4.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3841   -3.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2013   -3.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7499   -3.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5500   -4.7422    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.6176   -4.2202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6021   -2.8049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7292   -7.6364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4347   -4.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8485   -4.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6649   -4.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0666   -4.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6459   -3.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8309   -3.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9610   -7.6429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.0809   -5.6103    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.4118   -2.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  2  5  1  0
  3  4  1  0
  4  7  1  0
  6  5  1  0
  6  7  1  0
  6  9  1  0
  7  8  1  0
  8  1  1  0
  1 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
  7 18  1  1
  6 19  1  1
  9 20  1  6
 10 21  1  1
 13 22  1  1
 14 23  1  6
 17 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 24 28  1  6
 17 29  1  6
 27 30  1  0
 27 31  2  0
  3 32  1  6
 30 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
  1 39  1  1
 35 40  1  0
 38 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5092542

    ---

Associated Targets(non-human)

Clostridioides difficile (2968 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.71Molecular Weight (Monoisotopic): 499.3462AlogP: 6.48#Rotatable Bonds: 5
Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.72CX Basic pKa: CX LogP: 5.80CX LogD: 5.80
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: 0.99

References

1. Sharma SK, Yip C, Simon MP, Phan J, Abel-Santos E, Firestine SM..  (2021)  Studies on the Importance of the 7α-, and 12α- hydroxyl groups of N-Aryl-3α,7α,12α-trihydroxy-5β-cholan-24-amides on their Antigermination Activity Against a Hypervirulent Strain of Clostridioides (Clostridium) difficile.,  52  [PMID:34837818] [10.1016/j.bmc.2021.116503]

Source