The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2'-Methyl-5'-fluorophenyl)-3-alpha,7-beta-dihydroxy-5-beta-cholan-24-amide ID: ALA5092542
PubChem CID: 166634731
Max Phase: Preclinical
Molecular Formula: C31H46FNO3
Molecular Weight: 499.71
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(F)cc1NC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C31H46FNO3/c1-18(6-10-28(36)33-26-17-21(32)7-5-19(26)2)23-8-9-24-29-25(12-14-31(23,24)4)30(3)13-11-22(34)15-20(30)16-27(29)35/h5,7,17-18,20,22-25,27,29,34-35H,6,8-16H2,1-4H3,(H,33,36)/t18-,20+,22-,23-,24+,25+,27+,29+,30+,31-/m1/s1
Standard InChI Key: SGQIHGBJYFYCPM-PGGCCGQUSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
21.2552 -7.2309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4363 -6.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4363 -7.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1416 -7.6312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1416 -5.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8469 -6.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8434 -7.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5455 -7.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5524 -6.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2590 -6.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2759 -4.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5577 -5.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9825 -5.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9692 -6.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7437 -6.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2357 -5.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7652 -4.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8355 -8.0398 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.8396 -5.5924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5453 -6.8182 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.2511 -5.6006 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.9775 -4.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9610 -6.8347 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.1661 -4.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9833 -4.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3841 -3.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2013 -3.5170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7499 -3.5437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5500 -4.7422 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.6176 -4.2202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6021 -2.8049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7292 -7.6364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4347 -4.2113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8485 -4.9154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6649 -4.9069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0666 -4.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6459 -3.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8309 -3.5007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9610 -7.6429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0809 -5.6103 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.4118 -2.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 5 1 0
3 4 1 0
4 7 1 0
6 5 1 0
6 7 1 0
6 9 1 0
7 8 1 0
8 1 1 0
1 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
7 18 1 1
6 19 1 1
9 20 1 6
10 21 1 1
13 22 1 1
14 23 1 6
17 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
24 28 1 6
17 29 1 6
27 30 1 0
27 31 2 0
3 32 1 6
30 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
1 39 1 1
35 40 1 0
38 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.71Molecular Weight (Monoisotopic): 499.3462AlogP: 6.48#Rotatable Bonds: 5Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.72CX Basic pKa: ┄CX LogP: 5.80CX LogD: 5.80Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.43Np Likeness Score: 0.99
References 1. Sharma SK, Yip C, Simon MP, Phan J, Abel-Santos E, Firestine SM.. (2021) Studies on the Importance of the 7α-, and 12α- hydroxyl groups of N-Aryl-3α,7α,12α-trihydroxy-5β-cholan-24-amides on their Antigermination Activity Against a Hypervirulent Strain of Clostridioides (Clostridium) difficile., 52 [PMID:34837818 ] [10.1016/j.bmc.2021.116503 ]