The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(6,7-Dichloro-9-(1-methyl-1H-pyrazol-3-yl)-1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)-2-oxoethyl)-2-(5-methylisoxazol-3-yl)acetamide ID: ALA5092651
PubChem CID: 166631166
Max Phase: Preclinical
Molecular Formula: C23H22Cl2N6O3
Molecular Weight: 501.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(CC(=O)NCC(=O)N2CCc3[nH]c4c(Cl)c(Cl)cc(-c5ccn(C)n5)c4c3C2)no1
Standard InChI: InChI=1S/C23H22Cl2N6O3/c1-12-7-13(29-34-12)8-19(32)26-10-20(33)31-6-4-17-15(11-31)21-14(18-3-5-30(2)28-18)9-16(24)22(25)23(21)27-17/h3,5,7,9,27H,4,6,8,10-11H2,1-2H3,(H,26,32)
Standard InChI Key: IJEGHHSDTACIKA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
26.8132 -13.4300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8120 -14.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5242 -14.6626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5224 -13.0170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2310 -13.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2358 -14.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0200 -14.4976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.0122 -13.1648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5001 -13.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3111 -13.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6405 -12.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1568 -12.3248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3395 -12.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0999 -14.6617 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.5253 -15.4839 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
27.5168 -12.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1765 -11.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9216 -10.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1003 -10.9380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8502 -11.7200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.6138 -10.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4856 -11.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3020 -11.4831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0020 -10.9137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7896 -12.1460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6061 -12.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0896 -12.7195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9348 -11.3043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.9060 -12.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4599 -13.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2090 -12.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1196 -12.0809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3153 -11.9151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.9228 -13.3025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
2 14 1 0
3 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 16 2 0
4 16 1 0
19 21 1 0
12 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 1 0
33 29 2 0
31 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.37Molecular Weight (Monoisotopic): 500.1130AlogP: 3.42#Rotatable Bonds: 5Polar Surface Area: 109.05Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.99CX Basic pKa: 1.96CX LogP: 2.32CX LogD: 2.32Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -2.13
References 1. Tan J, Wu B, Chen T, Fan C, Zhao J, Xiong C, Feng C, Xiao R, Ding C, Tang W, Zhang A.. (2021) Synthesis and Pharmacological Evaluation of Tetrahydro-γ-carboline Derivatives as Potent Anti-inflammatory Agents Targeting Cyclic GMP-AMP Synthase., 64 (11.0): [PMID:34044539 ] [10.1021/acs.jmedchem.1c00398 ]