The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Gwanakoside B ID: ALA5092720
PubChem CID: 166632135
Max Phase: Preclinical
Molecular Formula: C29H26O11
Molecular Weight: 550.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc2c(c(O[C@@H]3O[C@@H](C)[C@@H](O)[C@@H](O)[C@H]3O)c1)-c1cc3c(c(O)c1[C@@H](O)C2)C(=O)c1c(O)cc(O)cc1C3=O
Standard InChI: InChI=1S/C29H26O11/c1-9-3-11-5-16(31)20-13(19(11)18(4-9)40-29-28(38)27(37)23(33)10(2)39-29)8-15-22(25(20)35)26(36)21-14(24(15)34)6-12(30)7-17(21)32/h3-4,6-8,10,16,23,27-33,35,37-38H,5H2,1-2H3/t10-,16-,23+,27+,28+,29-/m0/s1
Standard InChI Key: RGPYQSDFQFLOCA-XSUXDIDESA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
18.9747 -3.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2644 -3.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5585 -3.7892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5522 -4.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2626 -5.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9792 -4.6137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2598 -5.8409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6878 -3.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2671 -2.5579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8481 -3.3769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8409 -5.0153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7915 -8.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5053 -8.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5025 -7.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7897 -7.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0752 -8.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0793 -7.4788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3711 -7.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3629 -8.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6503 -8.2951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6573 -7.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9548 -7.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9448 -8.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2376 -8.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2434 -7.4690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8234 -8.2784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5277 -8.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8292 -7.4589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5393 -7.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5476 -6.2416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8465 -5.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1314 -6.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1267 -7.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3741 -6.2405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3600 -9.5380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7913 -9.5407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2169 -7.0554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9412 -9.5246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.5230 -9.5209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4264 -5.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 1
1 8 1 6
2 9 1 6
3 10 1 6
4 11 1 6
16 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 17 1 0
16 17 2 0
16 19 1 0
17 18 1 0
18 21 1 0
20 19 1 0
20 21 2 0
21 22 1 0
22 25 2 0
24 23 2 0
23 20 1 0
24 25 1 0
24 27 1 0
25 29 1 0
28 26 1 0
26 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
18 34 2 0
19 35 2 0
12 36 1 0
14 37 1 0
23 38 1 0
27 39 1 1
32 40 1 0
30 7 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 550.52Molecular Weight (Monoisotopic): 550.1475AlogP: 1.35#Rotatable Bonds: 2Polar Surface Area: 194.21Molecular Species: NEUTRALHBA: 11HBD: 7#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.29CX Basic pKa: ┄CX LogP: 3.28CX LogD: 2.89Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: 2.09
References 1. Huynh TH, Lee J, Moon DH, Nguyen TQ, Son S, Hwang S, Du YE, Cui J, Jang JH, Nam SJ, Shin J, Jang J, Lee SK, Oh KB, Oh DC.. (2022) Gwanakosides A and B, 6-Deoxy-α-l-talopyranose-Bearing Aromatic Metabolites from a Streptomyces sp. and Coculture with Pandoraea sp., 85 (1.0): [PMID:34931849 ] [10.1021/acs.jnatprod.1c00703 ]