The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6,7-Dichloro-9-(1-methyl-1H-pyrazol-3-yl)-1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)(3-(difluoromethoxy)cyclobutyl)methanone ID: ALA5092741
PubChem CID: 166632754
Max Phase: Preclinical
Molecular Formula: C21H20Cl2F2N4O2
Molecular Weight: 469.32
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cn1ccc(-c2cc(Cl)c(Cl)c3[nH]c4c(c23)CN(C(=O)C2CC(OC(F)F)C2)CC4)n1
Standard InChI: InChI=1S/C21H20Cl2F2N4O2/c1-28-4-2-16(27-28)12-8-14(22)18(23)19-17(12)13-9-29(5-3-15(13)26-19)20(30)10-6-11(7-10)31-21(24)25/h2,4,8,10-11,21,26H,3,5-7,9H2,1H3
Standard InChI Key: RXBBILWUSSSLFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
3.6842 -12.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6831 -13.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3911 -13.6019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3893 -11.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0979 -12.3698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1027 -13.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8828 -13.4369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8750 -12.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3587 -12.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1656 -12.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4950 -11.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0113 -11.2765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1982 -11.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9750 -13.6010 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.3922 -14.4191 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.3837 -11.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0434 -10.6678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7885 -9.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9713 -9.8938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7212 -10.6717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4889 -9.2341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3401 -10.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1523 -10.4389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8565 -9.8696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7881 -10.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2993 -10.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6617 -9.8015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1116 -10.2232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5951 -10.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4074 -10.7926 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.2664 -11.6302 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 1 0
8 5 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
2 14 1 0
3 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 16 2 0
4 16 1 0
19 21 1 0
12 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 469.32Molecular Weight (Monoisotopic): 468.0931AlogP: 4.78#Rotatable Bonds: 4Polar Surface Area: 63.15Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.94CX Basic pKa: 1.96CX LogP: 4.05CX LogD: 4.05Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -1.37
References 1. Tan J, Wu B, Chen T, Fan C, Zhao J, Xiong C, Feng C, Xiao R, Ding C, Tang W, Zhang A.. (2021) Synthesis and Pharmacological Evaluation of Tetrahydro-γ-carboline Derivatives as Potent Anti-inflammatory Agents Targeting Cyclic GMP-AMP Synthase., 64 (11.0): [PMID:34044539 ] [10.1021/acs.jmedchem.1c00398 ]