(6,7-Dichloro-9-(1-methyl-1H-pyrazol-3-yl)-1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)(3-(difluoromethoxy)cyclobutyl)methanone

ID: ALA5092741

PubChem CID: 166632754

Max Phase: Preclinical

Molecular Formula: C21H20Cl2F2N4O2

Molecular Weight: 469.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1ccc(-c2cc(Cl)c(Cl)c3[nH]c4c(c23)CN(C(=O)C2CC(OC(F)F)C2)CC4)n1

Standard InChI:  InChI=1S/C21H20Cl2F2N4O2/c1-28-4-2-16(27-28)12-8-14(22)18(23)19-17(12)13-9-29(5-3-15(13)26-19)20(30)10-6-11(7-10)31-21(24)25/h2,4,8,10-11,21,26H,3,5-7,9H2,1H3

Standard InChI Key:  RXBBILWUSSSLFC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    3.6842  -12.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6831  -13.1929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3911  -13.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3893  -11.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0979  -12.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1027  -13.1884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8828  -13.4369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8750  -12.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3587  -12.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1656  -12.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4950  -11.9341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0113  -11.2765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1982  -11.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9750  -13.6010    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.3922  -14.4191    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.3837  -11.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0434  -10.6678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7885   -9.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9713   -9.8938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7212  -10.6717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4889   -9.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3401  -10.5283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1523  -10.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8565   -9.8696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7881  -10.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2993  -10.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6617   -9.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1116  -10.2232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5951  -10.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4074  -10.7926    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.2664  -11.6302    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  2 14  1  0
  3 15  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 16  2  0
  4 16  1  0
 19 21  1  0
 12 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5092741

    ---

Associated Targets(Human)

THP1-Dual (100 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CGAS Tchem Cyclic GMP-AMP synthase (693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.32Molecular Weight (Monoisotopic): 468.0931AlogP: 4.78#Rotatable Bonds: 4
Polar Surface Area: 63.15Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.94CX Basic pKa: 1.96CX LogP: 4.05CX LogD: 4.05
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -1.37

References

1. Tan J, Wu B, Chen T, Fan C, Zhao J, Xiong C, Feng C, Xiao R, Ding C, Tang W, Zhang A..  (2021)  Synthesis and Pharmacological Evaluation of Tetrahydro-γ-carboline Derivatives as Potent Anti-inflammatory Agents Targeting Cyclic GMP-AMP Synthase.,  64  (11.0): [PMID:34044539] [10.1021/acs.jmedchem.1c00398]

Source