1-(6,7-Dichloro-9-(1-methyl-1H-pyrazol-3-yl)-1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)-2-(methylamino)ethan-1-one

ID: ALA5092887

PubChem CID: 166631177

Max Phase: Preclinical

Molecular Formula: C18H19Cl2N5O

Molecular Weight: 392.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNCC(=O)N1CCc2[nH]c3c(Cl)c(Cl)cc(-c4ccn(C)n4)c3c2C1

Standard InChI:  InChI=1S/C18H19Cl2N5O/c1-21-8-15(26)25-6-4-13-11(9-25)16-10(14-3-5-24(2)23-14)7-12(19)17(20)18(16)22-13/h3,5,7,21-22H,4,6,8-9H2,1-2H3

Standard InChI Key:  FXYAFKZPUXSIIR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   38.9101  -12.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9089  -13.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6170  -13.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6152  -12.0801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3238  -12.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3286  -13.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1087  -13.5524    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1009  -12.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5846  -12.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3915  -12.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7209  -12.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2372  -11.3920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4241  -11.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2009  -13.7165    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   39.6180  -14.5346    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   39.6096  -11.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2693  -10.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0144  -10.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1972  -10.0093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9471  -10.7873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.7148   -9.3497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5659  -10.6439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3782  -10.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0824   -9.9851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8618  -11.2133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.6741  -11.1239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  2 14  1  0
  3 15  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 16  2  0
  4 16  1  0
 19 21  1  0
 12 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5092887

    ---

Associated Targets(Human)

THP1-Dual (100 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CGAS Tchem Cyclic GMP-AMP synthase (693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cgas Cyclic GMP-AMP synthase (121 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.29Molecular Weight (Monoisotopic): 391.0967AlogP: 2.98#Rotatable Bonds: 3
Polar Surface Area: 65.95Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.94CX Basic pKa: 8.81CX LogP: 2.15CX LogD: 0.72
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.72Np Likeness Score: -1.53

References

1. Tan J, Wu B, Chen T, Fan C, Zhao J, Xiong C, Feng C, Xiao R, Ding C, Tang W, Zhang A..  (2021)  Synthesis and Pharmacological Evaluation of Tetrahydro-γ-carboline Derivatives as Potent Anti-inflammatory Agents Targeting Cyclic GMP-AMP Synthase.,  64  (11.0): [PMID:34044539] [10.1021/acs.jmedchem.1c00398]

Source