The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
biphenyl-2,3',4,5',6-pentakisphosphate ID: ALA5092991
Cas Number: 943545-68-4
PubChem CID: 56973420
Max Phase: Preclinical
Molecular Formula: C12H15O20P5
Molecular Weight: 634.10
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=P(O)(O)Oc1cc(OP(=O)(O)O)cc(-c2c(OP(=O)(O)O)cc(OP(=O)(O)O)cc2OP(=O)(O)O)c1
Standard InChI: InChI=1S/C12H15O20P5/c13-33(14,15)28-7-1-6(2-8(3-7)29-34(16,17)18)12-10(31-36(22,23)24)4-9(30-35(19,20)21)5-11(12)32-37(25,26)27/h1-5H,(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27)
Standard InChI Key: ZCSNVIKBMFGCLE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
8.2627 -3.3802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8582 -2.6703 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
7.4451 -3.3776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2627 -5.8483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8582 -5.1384 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
7.4451 -5.8457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8388 -8.3164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4343 -7.6065 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
6.0213 -8.3138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9952 -5.8524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5866 -5.1425 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.1776 -5.8498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9952 -3.3926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5866 -2.6827 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.1776 -3.3900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0132 -2.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0120 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7242 -3.9153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4380 -3.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4352 -2.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7224 -2.2697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7259 -4.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0123 -5.1464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0118 -5.9669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7240 -6.3765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4383 -5.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4354 -5.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1454 -2.2637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3012 -2.2701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1462 -4.7300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7249 -7.1978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3010 -4.7328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8817 -2.2704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5650 -2.2583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5657 -4.7265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1486 -7.1963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8815 -4.7310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
8 7 1 0
9 8 1 0
11 10 1 0
12 11 1 0
14 13 1 0
15 14 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
18 22 1 0
20 28 1 0
16 29 1 0
27 30 1 0
25 31 1 0
23 32 1 0
28 2 1 0
30 5 1 0
31 8 1 0
32 11 1 0
29 14 1 0
14 33 2 0
2 34 2 0
5 35 2 0
8 36 2 0
11 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 634.10Molecular Weight (Monoisotopic): 633.8845AlogP: 0.71#Rotatable Bonds: 11Polar Surface Area: 333.80Molecular Species: ACIDHBA: 10HBD: 10#RO5 Violations: 2HBA (Lipinski): 20HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.17CX Basic pKa: ┄CX LogP: -1.17CX LogD: -13.66Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.15Np Likeness Score: 0.31
References 1. Whitfield H, Hemmings AM, Mills SJ, Baker K, White G, Rushworth S, Riley AM, Potter BVL, Brearley CA.. (2021) Allosteric Site on SHIP2 Identified Through Fluorescent Ligand Screening and Crystallography: A Potential New Target for Intervention., 64 (7.0): [PMID:33724834 ] [10.1021/acs.jmedchem.0c01944 ]