2-chloro-N-(4-((3-methoxyphenyl)amino)quinazolin-6-yl)acetamide

ID: ALA5093024

PubChem CID: 147429745

Max Phase: Preclinical

Molecular Formula: C17H15ClN4O2

Molecular Weight: 342.79

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(Nc2ncnc3ccc(NC(=O)CCl)cc23)c1

Standard InChI:  InChI=1S/C17H15ClN4O2/c1-24-13-4-2-3-11(7-13)22-17-14-8-12(21-16(23)9-18)5-6-15(14)19-10-20-17/h2-8,10H,9H2,1H3,(H,21,23)(H,19,20,22)

Standard InChI Key:  DUCFIGVCALQJJI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -1.7833   -1.4429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0688   -1.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568   -1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568   -2.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0669   -2.6794    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7833   -2.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3558   -1.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0706   -1.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0725   -2.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3608   -2.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7853   -1.0315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -1.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146   -1.0315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -2.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146   -2.6819    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.0688   -0.2054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7833    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4981   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2103    0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2103    1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5000    1.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7833    1.0358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5000    2.2692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2146    2.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
  2 16  1  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 21 23  1  0
 23 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093024

    ---

Associated Targets(Human)

GMPS Tbio GMP synthase [glutamine-hydrolyzing] (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 342.79Molecular Weight (Monoisotopic): 342.0884AlogP: 3.56#Rotatable Bonds: 5
Polar Surface Area: 76.14Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.29CX Basic pKa: 3.98CX LogP: 3.08CX LogD: 3.08
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.69Np Likeness Score: -1.71

References

1.  (2020)  Novel inhibitors of guanosine monophosphate synthetase as therapeutic agents, 

Source