3-(4-methoxyphenyl)-N-(2-piperazin-1-ylpyrimidin-4-yl)isoxazol-5-amine

ID: ALA5093087

PubChem CID: 156368926

Max Phase: Preclinical

Molecular Formula: C18H20N6O2

Molecular Weight: 352.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc(Nc3ccnc(N4CCNCC4)n3)on2)cc1

Standard InChI:  InChI=1S/C18H20N6O2/c1-25-14-4-2-13(3-5-14)15-12-17(26-23-15)21-16-6-7-20-18(22-16)24-10-8-19-9-11-24/h2-7,12,19H,8-11H2,1H3,(H,20,21,22)

Standard InChI Key:  IUUDCKYRPALVJN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    8.0790   -5.0497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1330   -4.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4944   -3.2502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6637   -3.2502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0251   -4.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1547   -4.6651    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9817   -3.8381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6793   -2.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5046   -1.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6346   -2.1873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9380   -3.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1163   -4.1421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0677   -3.6135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8947   -2.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0243   -3.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3270   -4.2190    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5001   -5.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3704   -4.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0034   -4.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7003   -5.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5737   -6.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7465   -5.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0455   -4.1436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1728   -3.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6168   -5.5710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7898   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  5  6  1  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
  7 12  1  0
 13 11  1  0
 13 14  1  0
 15 14  1  0
 16 15  1  0
 16 17  1  0
 18 17  1  0
 13 18  1  0
 19  2  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 22 25  1  0
 25 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093087

    ---

Associated Targets(Human)

JIMT-1 (237 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 352.40Molecular Weight (Monoisotopic): 352.1648AlogP: 2.29#Rotatable Bonds: 5
Polar Surface Area: 88.34Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.35CX Basic pKa: 8.97CX LogP: 1.99CX LogD: 1.34
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.72Np Likeness Score: -1.57

References

1.  (2021)  Isoxazole derivatives targeting tacc3 as anticancer agents, 

Source