The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[5-(1,3-benzothiazol-5-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-[3-[2-methoxyethyl(methyl)amino]phenyl]ethanone ID: ALA5093145
PubChem CID: 166631184
Max Phase: Preclinical
Molecular Formula: C25H28N4O5S2
Molecular Weight: 528.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCN(C)c1cccc(C(O)C(=O)N2CC3=C(C2)CN(S(=O)(=O)c2ccc4scnc4c2)C3)c1
Standard InChI: InChI=1S/C25H28N4O5S2/c1-27(8-9-34-2)20-5-3-4-17(10-20)24(30)25(31)28-12-18-14-29(15-19(18)13-28)36(32,33)21-6-7-23-22(11-21)26-16-35-23/h3-7,10-11,16,24,30H,8-9,12-15H2,1-2H3
Standard InChI Key: OOCXQEDAHCDGFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-5.1026 -0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1026 -0.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3893 -1.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6822 -0.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6822 -0.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3910 0.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9679 -1.2518 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.2536 -0.8395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1675 -0.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3611 0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9489 -0.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5006 -1.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1426 -0.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0565 0.4289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8095 0.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6577 0.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6577 1.6660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3720 0.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0863 0.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9679 -2.0766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2536 -1.6642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8035 0.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5150 0.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7990 2.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5135 1.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0865 1.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3720 -0.3958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2293 0.4310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9435 0.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6578 -0.3937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9435 -0.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2293 -0.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3721 -0.8061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8872 0.2366 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.8872 -1.0981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.3721 -0.4306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
11 13 1 0
13 14 1 0
14 15 1 0
10 15 1 0
14 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
7 20 2 0
7 21 2 0
19 22 1 0
22 23 2 0
25 24 2 0
25 23 1 0
24 26 1 0
26 19 2 0
18 27 1 0
28 23 1 0
28 29 1 0
31 30 1 0
28 32 1 0
32 31 1 0
30 33 1 0
1 34 1 0
2 35 1 0
35 36 2 0
36 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.66Molecular Weight (Monoisotopic): 528.1501AlogP: 2.26#Rotatable Bonds: 8Polar Surface Area: 103.28Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.51CX Basic pKa: 2.95CX LogP: 1.08CX LogD: 1.08Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: -1.46
References 1. (2020) Inhibiting ubiquitin specific peptidase 9x,