1-[5-(1,3-benzothiazol-5-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-[3-[2-methoxyethyl(methyl)amino]phenyl]ethanone

ID: ALA5093145

PubChem CID: 166631184

Max Phase: Preclinical

Molecular Formula: C25H28N4O5S2

Molecular Weight: 528.66

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCN(C)c1cccc(C(O)C(=O)N2CC3=C(C2)CN(S(=O)(=O)c2ccc4scnc4c2)C3)c1

Standard InChI:  InChI=1S/C25H28N4O5S2/c1-27(8-9-34-2)20-5-3-4-17(10-20)24(30)25(31)28-12-18-14-29(15-19(18)13-28)36(32,33)21-6-7-23-22(11-21)26-16-35-23/h3-7,10-11,16,24,30H,8-9,12-15H2,1-2H3

Standard InChI Key:  OOCXQEDAHCDGFC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -5.1026   -0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1026   -0.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3893   -1.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6822   -0.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6822   -0.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3910    0.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9679   -1.2518    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2536   -0.8395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1675   -0.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3611    0.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9489   -0.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5006   -1.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1426   -0.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0565    0.4289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8095    0.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6577    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6577    1.6660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3720    0.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0863    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9679   -2.0766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2536   -1.6642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8035    0.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5150    0.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7990    2.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5135    1.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0865    1.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3720   -0.3958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2293    0.4310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9435    0.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6578   -0.3937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9435   -0.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2293   -0.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3721   -0.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8872    0.2366    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8872   -1.0981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3721   -0.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 14 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
  7 20  2  0
  7 21  2  0
 19 22  1  0
 22 23  2  0
 25 24  2  0
 25 23  1  0
 24 26  1  0
 26 19  2  0
 18 27  1  0
 28 23  1  0
 28 29  1  0
 31 30  1  0
 28 32  1  0
 32 31  1  0
 30 33  1  0
  1 34  1  0
  2 35  1  0
 35 36  2  0
 36 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093145

    ---

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 528.66Molecular Weight (Monoisotopic): 528.1501AlogP: 2.26#Rotatable Bonds: 8
Polar Surface Area: 103.28Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.51CX Basic pKa: 2.95CX LogP: 1.08CX LogD: 1.08
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.45Np Likeness Score: -1.46

References

1.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 

Source