The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(4-(2-(5-amino-2-(furan-2-yl)-7H-pyrazolo[4,3-e][1,2,4]triazolo[1,5-c]pyrimidin-7-yl)ethyl)phenyl)-N8-hydroxyoctanediamide ID: ALA5093149
PubChem CID: 166631536
Max Phase: Preclinical
Molecular Formula: C26H29N9O4
Molecular Weight: 531.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc2c(cnn2CCc2ccc(NC(=O)CCCCCCC(=O)NO)cc2)c2nc(-c3ccco3)nn12
Standard InChI: InChI=1S/C26H29N9O4/c27-26-31-24-19(25-30-23(32-35(25)26)20-6-5-15-39-20)16-28-34(24)14-13-17-9-11-18(12-10-17)29-21(36)7-3-1-2-4-8-22(37)33-38/h5-6,9-12,15-16,38H,1-4,7-8,13-14H2,(H2,27,31)(H,29,36)(H,33,37)
Standard InChI Key: GDORGFVYOGNYSG-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
23.9169 -23.2336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6222 -22.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3274 -23.2336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3274 -24.0473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1013 -24.2988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5796 -23.6405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1013 -22.9823 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6222 -22.0037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3948 -23.6410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8752 -24.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6524 -24.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6524 -23.2324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8752 -22.9800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6222 -24.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9196 -24.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3211 -24.5984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6537 -25.3359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.4577 -25.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5209 -24.4323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9770 -25.0423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1769 -24.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9234 -24.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1241 -23.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5793 -24.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8394 -25.3228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6381 -25.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7790 -24.3786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2359 -24.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4355 -24.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8925 -25.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0921 -25.2699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5490 -25.8805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7487 -25.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4932 -25.7649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2056 -26.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4052 -26.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8621 -26.7718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1479 -25.3855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0618 -26.6068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 15 1 0
1 2 2 0
14 4 1 0
3 2 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 3 1 0
2 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
6 9 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
16 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
28 34 2 0
33 35 1 0
35 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.58Molecular Weight (Monoisotopic): 531.2343AlogP: 3.34#Rotatable Bonds: 12Polar Surface Area: 178.49Molecular Species: NEUTRALHBA: 11HBD: 4#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.91CX Basic pKa: 1.05CX LogP: 3.10CX LogD: 3.09Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.11Np Likeness Score: -1.54
References 1. Yan W, Ling L, Wu Y, Yang K, Liu R, Zhang J, Zhao S, Zhong G, Zhao S, Jiang H, Xie C, Cheng J.. (2021) Structure-Based Design of Dual-Acting Compounds Targeting Adenosine A2A Receptor and Histone Deacetylase as Novel Tumor Immunotherapeutic Agents., 64 (22.0): [PMID:34783558 ] [10.1021/acs.jmedchem.1c01155 ]