3-(benzyl(3-(phenylthio)benzyl)amino)propanoic acid

ID: ALA5093194

PubChem CID: 166631839

Max Phase: Preclinical

Molecular Formula: C23H23NO2S

Molecular Weight: 377.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CCN(Cc1ccccc1)Cc1cccc(Sc2ccccc2)c1

Standard InChI:  InChI=1S/C23H23NO2S/c25-23(26)14-15-24(17-19-8-3-1-4-9-19)18-20-10-7-13-22(16-20)27-21-11-5-2-6-12-21/h1-13,16H,14-15,17-18H2,(H,25,26)

Standard InChI Key:  AIZIEOXWPYNMIM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   12.7443   -9.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7431  -10.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4579  -11.0818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1743  -10.6684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1715   -9.8379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4561   -9.4287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8844   -9.4227    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.6004   -9.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6002  -10.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3154  -11.0649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0292  -10.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0235   -9.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3077   -9.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0297   -9.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0295   -8.6043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3150   -8.1919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7439   -8.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7437   -7.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6006   -8.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8860   -8.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1716   -8.6049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8859   -7.3673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4578   -6.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4580   -6.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7429   -5.7223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0262   -6.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0295   -6.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 18 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 18  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093194

    ---

Associated Targets(non-human)

ftsZ Cell division protein FtsZ (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.51Molecular Weight (Monoisotopic): 377.1449AlogP: 5.31#Rotatable Bonds: 9
Polar Surface Area: 40.54Molecular Species: ZWITTERIONHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.42CX Basic pKa: 8.79CX LogP: 2.82CX LogD: 2.80
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.55Np Likeness Score: -0.99

References

1. Huecas S, Araújo-Bazán L, Ruiz FM, Ruiz-Ávila LB, Martínez RF, Escobar-Peña A, Artola M, Vázquez-Villa H, Martín-Fontecha M, Fernández-Tornero C, López-Rodríguez ML, Andreu JM..  (2021)  Targeting the FtsZ Allosteric Binding Site with a Novel Fluorescence Polarization Screen, Cytological and Structural Approaches for Antibacterial Discovery.,  64  (9.0): [PMID:33908781] [10.1021/acs.jmedchem.0c02207]

Source