(3-chlorophenyl)-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]methanol

ID: ALA5093224

PubChem CID: 162773063

Max Phase: Preclinical

Molecular Formula: C22H19ClN2O5S

Molecular Weight: 458.92

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(c1ccc2c(c1)OCCO2)N1Cc2cnc(C(O)c3cccc(Cl)c3)cc2C1

Standard InChI:  InChI=1S/C22H19ClN2O5S/c23-17-3-1-2-14(8-17)22(26)19-9-15-12-25(13-16(15)11-24-19)31(27,28)18-4-5-20-21(10-18)30-7-6-29-20/h1-5,8-11,22,26H,6-7,12-13H2

Standard InChI Key:  NUVSWLHAVWUMIB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -4.2716   -0.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5570   -0.1908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8451   -0.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8451   -1.4279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5552   -1.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2716   -1.4316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1305   -0.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1305    0.6349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4158   -0.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7010   -0.1903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0110   -0.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0110   -1.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6992   -1.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4158   -1.4315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7959   -1.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7960   -0.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2811   -1.0152    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1063   -1.0152    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5189   -0.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1065    0.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5185    1.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3439    1.1263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7558    0.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3476   -0.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7531    1.8381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5742    1.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9862    1.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5770    0.4176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5189   -1.7298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9315   -1.0152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9862   -0.1906    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  7  8  1  0
  7  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 12 15  1  0
 11 16  1  0
 16 17  1  0
 17 15  1  0
 17 18  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 22 25  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 23 28  1  0
 18 29  2  0
 18 30  2  0
  1 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093224

    ---

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.92Molecular Weight (Monoisotopic): 458.0703AlogP: 3.29#Rotatable Bonds: 4
Polar Surface Area: 88.96Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.96CX Basic pKa: 3.81CX LogP: 2.65CX LogD: 2.65
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.13

References

1.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 

Source