The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3-chlorophenyl)-[2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]methanol ID: ALA5093224
PubChem CID: 162773063
Max Phase: Preclinical
Molecular Formula: C22H19ClN2O5S
Molecular Weight: 458.92
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(c1ccc2c(c1)OCCO2)N1Cc2cnc(C(O)c3cccc(Cl)c3)cc2C1
Standard InChI: InChI=1S/C22H19ClN2O5S/c23-17-3-1-2-14(8-17)22(26)19-9-15-12-25(13-16(15)11-24-19)31(27,28)18-4-5-20-21(10-18)30-7-6-29-20/h1-5,8-11,22,26H,6-7,12-13H2
Standard InChI Key: NUVSWLHAVWUMIB-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-4.2716 -0.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5570 -0.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8451 -0.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8451 -1.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5552 -1.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2716 -1.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1305 -0.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1305 0.6349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4158 -0.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7010 -0.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0110 -0.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0110 -1.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6992 -1.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4158 -1.4315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7959 -1.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7960 -0.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2811 -1.0152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1063 -1.0152 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5189 -0.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1065 0.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5185 1.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3439 1.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7558 0.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3476 -0.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7531 1.8381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5742 1.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9862 1.1294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5770 0.4176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5189 -1.7298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9315 -1.0152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9862 -0.1906 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
7 9 1 0
10 9 2 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 2 0
9 14 1 0
12 15 1 0
11 16 1 0
16 17 1 0
17 15 1 0
17 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
22 25 1 0
26 25 1 0
27 26 1 0
28 27 1 0
23 28 1 0
18 29 2 0
18 30 2 0
1 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.92Molecular Weight (Monoisotopic): 458.0703AlogP: 3.29#Rotatable Bonds: 4Polar Surface Area: 88.96Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.96CX Basic pKa: 3.81CX LogP: 2.65CX LogD: 2.65Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: -1.13
References 1. (2020) Inhibiting ubiquitin specific peptidase 9x,