The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(6,7-Dichloro-9b-(4,6-difluoro-1H-indol-3-yl)-1,3,4,9b-tetrahydro-2H-pyrido[4,3-b]indol-2-yl)-2-hydroxyethan-1-one ID: ALA5093281
PubChem CID: 166633056
Max Phase: Preclinical
Molecular Formula: C21H15Cl2F2N3O2
Molecular Weight: 450.27
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CO)N1CCC2=Nc3c(ccc(Cl)c3Cl)C2(c2c[nH]c3cc(F)cc(F)c23)C1
Standard InChI: InChI=1S/C21H15Cl2F2N3O2/c22-13-2-1-11-20(19(13)23)27-16-3-4-28(17(30)8-29)9-21(11,16)12-7-26-15-6-10(24)5-14(25)18(12)15/h1-2,5-7,26,29H,3-4,8-9H2
Standard InChI Key: YQPHVKHOHUERKY-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
3.3965 -18.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9113 -19.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2501 -19.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2202 -18.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5632 -19.2813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0793 -19.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5751 -20.6244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3563 -19.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3641 -20.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0804 -20.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7935 -20.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7817 -19.5151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0649 -19.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0916 -19.0330 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.7681 -20.5413 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.4928 -19.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2101 -19.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4867 -18.2757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9214 -19.0891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3506 -18.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9241 -17.4332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6758 -18.2204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7497 -17.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0097 -18.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8130 -18.3741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3570 -17.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0965 -16.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2938 -16.8148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6437 -16.3582 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.0704 -19.0408 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 9 2 0
8 5 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
2 14 1 0
3 15 1 0
12 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
8 20 1 0
20 24 1 0
23 21 1 0
21 22 1 0
22 20 2 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
27 29 1 0
25 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.27Molecular Weight (Monoisotopic): 449.0509AlogP: 4.35#Rotatable Bonds: 2Polar Surface Area: 68.69Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.62CX Basic pKa: 3.35CX LogP: 3.73CX LogD: 3.73Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.61Np Likeness Score: -0.52
References 1. Tan J, Wu B, Chen T, Fan C, Zhao J, Xiong C, Feng C, Xiao R, Ding C, Tang W, Zhang A.. (2021) Synthesis and Pharmacological Evaluation of Tetrahydro-γ-carboline Derivatives as Potent Anti-inflammatory Agents Targeting Cyclic GMP-AMP Synthase., 64 (11.0): [PMID:34044539 ] [10.1021/acs.jmedchem.1c00398 ]