The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-[3-(4-methylpiperazin-1-yl)phenyl]ethanethione ID: ALA5093412
PubChem CID: 162477328
Max Phase: Preclinical
Molecular Formula: C27H32N4O5S2
Molecular Weight: 556.71
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2cccc(C(O)C(=S)N3CC4=C(C3)CN(S(=O)(=O)c3ccc5c(c3)OCCO5)C4)c2)CC1
Standard InChI: InChI=1S/C27H32N4O5S2/c1-28-7-9-29(10-8-28)22-4-2-3-19(13-22)26(32)27(37)30-15-20-17-31(18-21(20)16-30)38(33,34)23-5-6-24-25(14-23)36-12-11-35-24/h2-6,13-14,26,32H,7-12,15-18H2,1H3
Standard InChI Key: BXXZJVZPFHVSIV-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-5.0228 -0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0228 -0.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3095 -1.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6024 -0.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6024 -0.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3113 0.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8881 -1.2518 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.1739 -0.8395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0878 -0.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2813 0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8692 -0.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4209 -1.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0629 -0.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0232 0.4289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7298 0.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7375 0.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7375 1.6660 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4517 0.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1660 0.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8881 -2.0766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1739 -1.6642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7373 -1.2556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4518 -0.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4518 -0.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7373 0.3942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4517 -0.3958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5932 1.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5948 0.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8788 2.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8833 0.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1663 1.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3091 0.4310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0233 0.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7376 0.4310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7376 -0.3937 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0233 -0.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3091 -0.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4518 -0.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
11 13 1 0
13 14 1 0
14 15 1 0
10 15 1 0
14 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
7 20 2 0
7 21 2 0
2 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
1 25 1 0
18 26 1 0
27 28 1 0
27 29 2 0
19 30 1 0
28 30 2 0
29 31 1 0
31 19 2 0
32 28 1 0
32 33 1 0
34 33 1 0
35 34 1 0
36 35 1 0
32 37 1 0
37 36 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.71Molecular Weight (Monoisotopic): 556.1814AlogP: 1.89#Rotatable Bonds: 5Polar Surface Area: 85.79Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.40CX Basic pKa: 7.89CX LogP: 1.24CX LogD: 0.63Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.44Np Likeness Score: -1.13
References 1. (2020) Inhibiting ubiquitin specific peptidase 9x, 2. (2020) Inhibiting ubiquitin specific peptidase 9x,