1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-hydroxy-2-[3-(4-methylpiperazin-1-yl)phenyl]ethanethione

ID: ALA5093412

PubChem CID: 162477328

Max Phase: Preclinical

Molecular Formula: C27H32N4O5S2

Molecular Weight: 556.71

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(c2cccc(C(O)C(=S)N3CC4=C(C3)CN(S(=O)(=O)c3ccc5c(c3)OCCO5)C4)c2)CC1

Standard InChI:  InChI=1S/C27H32N4O5S2/c1-28-7-9-29(10-8-28)22-4-2-3-19(13-22)26(32)27(37)30-15-20-17-31(18-21(20)16-30)38(33,34)23-5-6-24-25(14-23)36-12-11-35-24/h2-6,13-14,26,32H,7-12,15-18H2,1H3

Standard InChI Key:  BXXZJVZPFHVSIV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -5.0228   -0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0228   -0.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3095   -1.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6024   -0.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6024   -0.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3113    0.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8881   -1.2518    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1739   -0.8395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0878   -0.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2813    0.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8692   -0.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4209   -1.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0629   -0.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0232    0.4289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7298    0.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7375    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7375    1.6660    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.4517    0.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1660    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8881   -2.0766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1739   -1.6642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7373   -1.2556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4518   -0.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4518   -0.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7373    0.3942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4517   -0.3958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5932    1.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5948    0.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8788    2.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8833    0.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1663    1.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3091    0.4310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0233    0.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7376    0.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7376   -0.3937    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0233   -0.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3091   -0.3937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4518   -0.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 14 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
  7 20  2  0
  7 21  2  0
  2 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  1 25  1  0
 18 26  1  0
 27 28  1  0
 27 29  2  0
 19 30  1  0
 28 30  2  0
 29 31  1  0
 31 19  2  0
 32 28  1  0
 32 33  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 32 37  1  0
 37 36  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093412

    ---

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.71Molecular Weight (Monoisotopic): 556.1814AlogP: 1.89#Rotatable Bonds: 5
Polar Surface Area: 85.79Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.40CX Basic pKa: 7.89CX LogP: 1.24CX LogD: 0.63
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.44Np Likeness Score: -1.13

References

1.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 
2.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 

Source