The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(azetidin-3-yloxy)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-phenyl-ethanone ID: ALA5093431
PubChem CID: 146447943
Max Phase: Preclinical
Molecular Formula: C25H27N3O6S
Molecular Weight: 497.57
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(C(OC1CNC1)c1ccccc1)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCO3)C2
Standard InChI: InChI=1S/C25H27N3O6S/c29-25(24(34-20-11-26-12-20)17-4-2-1-3-5-17)27-13-18-15-28(16-19(18)14-27)35(30,31)21-6-7-22-23(10-21)33-9-8-32-22/h1-7,10,20,24,26H,8-9,11-16H2
Standard InChI Key: PLWHSFFYGXOESL-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
-3.5944 -0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5944 -0.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8811 -1.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1739 -0.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1739 -0.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8828 0.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4597 -1.2518 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.7454 -0.8395 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6593 -0.0196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1470 0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5592 -0.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0075 -1.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3655 -0.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4517 0.4289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6986 0.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1659 0.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1659 1.6660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8802 0.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5945 0.8413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4597 -2.0766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7454 -1.6642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3088 -1.2556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0233 -0.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0233 -0.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3088 0.3942 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8802 -0.3958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0217 1.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0233 0.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3073 2.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3118 0.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5948 1.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1660 -0.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9489 -1.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1521 -1.4049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3692 -0.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
11 13 1 0
13 14 1 0
14 15 1 0
10 15 1 0
14 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
7 20 2 0
7 21 2 0
2 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
1 25 1 0
18 26 1 0
27 28 1 0
27 29 2 0
19 30 1 0
28 30 2 0
29 31 1 0
31 19 2 0
26 32 1 0
33 32 1 0
34 33 1 0
34 35 1 0
35 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.57Molecular Weight (Monoisotopic): 497.1621AlogP: 1.33#Rotatable Bonds: 6Polar Surface Area: 97.41Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.47CX LogP: 0.56CX LogD: -0.54Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: -0.81
References 1. (2020) Inhibiting ubiquitin specific peptidase 9x, 2. (2020) Inhibiting ubiquitin specific peptidase 9x,