2-(azetidin-3-yloxy)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-phenyl-ethanone

ID: ALA5093431

PubChem CID: 146447943

Max Phase: Preclinical

Molecular Formula: C25H27N3O6S

Molecular Weight: 497.57

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(C(OC1CNC1)c1ccccc1)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCO3)C2

Standard InChI:  InChI=1S/C25H27N3O6S/c29-25(24(34-20-11-26-12-20)17-4-2-1-3-5-17)27-13-18-15-28(16-19(18)14-27)35(30,31)21-6-7-22-23(10-21)33-9-8-32-22/h1-7,10,20,24,26H,8-9,11-16H2

Standard InChI Key:  PLWHSFFYGXOESL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   -3.5944   -0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5944   -0.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8811   -1.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1739   -0.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1739   -0.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8828    0.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4597   -1.2518    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454   -0.8395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6593   -0.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1470    0.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5592   -0.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0075   -1.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3655   -0.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4517    0.4289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6986    0.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1659    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1659    1.6660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8802    0.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5945    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4597   -2.0766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454   -1.6642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3088   -1.2556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0233   -0.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0233   -0.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3088    0.3942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8802   -0.3958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0217    1.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0233    0.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3073    2.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3118    0.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5948    1.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1660   -0.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9489   -1.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1521   -1.4049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3692   -0.5946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 14 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
  7 20  2  0
  7 21  2  0
  2 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  1 25  1  0
 18 26  1  0
 27 28  1  0
 27 29  2  0
 19 30  1  0
 28 30  2  0
 29 31  1  0
 31 19  2  0
 26 32  1  0
 33 32  1  0
 34 33  1  0
 34 35  1  0
 35 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093431

    ---

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.57Molecular Weight (Monoisotopic): 497.1621AlogP: 1.33#Rotatable Bonds: 6
Polar Surface Area: 97.41Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.47CX LogP: 0.56CX LogD: -0.54
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.60Np Likeness Score: -0.81

References

1.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 
2.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 

Source