Methyl 7-Methoxy-6-[4-(methylamino)phenyl]benzo[d][1,3]dioxole-5-carboxylate

ID: ALA5093445

PubChem CID: 166631850

Max Phase: Preclinical

Molecular Formula: C17H17NO5

Molecular Weight: 315.32

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNc1ccc(-c2c(C(=O)OC)cc3c(c2OC)OCO3)cc1

Standard InChI:  InChI=1S/C17H17NO5/c1-18-11-6-4-10(5-7-11)14-12(17(19)21-3)8-13-15(16(14)20-2)23-9-22-13/h4-8,18H,9H2,1-3H3

Standard InChI Key:  FMUZUCWGHCKTIY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    4.4849  -25.1183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4837  -25.9378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1918  -26.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9014  -25.9373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8986  -25.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1900  -24.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1847  -23.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8929  -23.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8908  -22.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4781  -23.4914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4725  -22.6763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1803  -22.2632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0061  -21.4623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1906  -21.3804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8609  -22.1308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7727  -23.9040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0627  -23.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6014  -23.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6030  -24.7094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3083  -23.4822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0168  -23.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1916  -27.1640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8992  -27.5727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
  6  7  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 10 16  1  0
 16 17  1  0
  8 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
  3 22  1  0
 22 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093445

    ---

Associated Targets(Human)

HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-HEP1 (1155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TARBP2 Tchem TAR RNA binding protein 2 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 315.32Molecular Weight (Monoisotopic): 315.1107AlogP: 2.92#Rotatable Bonds: 4
Polar Surface Area: 66.02Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.05CX LogP: 2.56CX LogD: 2.56
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.88Np Likeness Score: 0.46

References

1. Zhou Z, Li Y, Ma X, Cao B, Peng T, Sheng Y, Peng H, Li R, Cao Y, Xi R, Li F, Wang M, Sun H, Zhang G, Zhang H, Hu K, Xiao W, Wang F..  (2021)  Identification of a Novel TAR RNA-Binding Protein 2 Modulator with Potential Therapeutic Activity against Hepatocellular Carcinoma.,  64  (11.0): [PMID:34038111] [10.1021/acs.jmedchem.1c00018]

Source