(5R)-4-(5-bromofuran-2-carbonyl)-5-(3,5-dimethylphenyl)-7-methyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one

ID: ALA5093469

PubChem CID: 166632488

Max Phase: Preclinical

Molecular Formula: C23H21BrN2O3

Molecular Weight: 453.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)cc([C@@H]2c3cc(C)ccc3NC(=O)CN2C(=O)c2ccc(Br)o2)c1

Standard InChI:  InChI=1S/C23H21BrN2O3/c1-13-4-5-18-17(11-13)22(16-9-14(2)8-15(3)10-16)26(12-21(27)25-18)23(28)19-6-7-20(24)29-19/h4-11,22H,12H2,1-3H3,(H,25,27)/t22-/m1/s1

Standard InChI Key:  PJUHEQROQNUIBK-JOCHJYFZSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.9181   -3.4416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9181   -4.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6330   -4.6818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3475   -4.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3475   -3.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6312   -3.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9946   -2.9161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8043   -3.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1648   -3.8402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8098   -4.5916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0000   -4.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8199   -5.5857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0334   -5.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8530   -6.6341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4605   -7.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2511   -6.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4276   -6.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8601   -7.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0656   -6.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3281   -5.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0314   -6.0033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1431   -5.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7255   -5.6872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4612   -5.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3332   -4.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5185   -4.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1957   -5.6892    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    6.3155   -2.4463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2034   -4.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 11 10  1  0
  4 11  1  0
 11 12  1  6
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 16 18  1  0
 14 19  1  0
 10 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  2  0
 24 27  1  0
  8 28  2  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093469

    ---

Associated Targets(Human)

PRMT6 Tchem Protein arginine N-methyltransferase 6 (321 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 453.34Molecular Weight (Monoisotopic): 452.0736AlogP: 5.15#Rotatable Bonds: 2
Polar Surface Area: 62.55Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.22CX Basic pKa: CX LogP: 4.79CX LogD: 4.79
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: -1.15

References

1. Xiong B..  (2021)  Allosteric Modulation: Dynamics is Double-"E"dged.,  64  (7.0): [PMID:33761250] [10.1021/acs.jmedchem.1c00473]

Source