(R)-N-((S)-1-amino-3-(2-bromophenyl)-1-oxopropan-2-yl)-2-(3,3-diphenylacrylamido)-5-guanidinopentanamide

ID: ALA5093771

PubChem CID: 166634132

Max Phase: Preclinical

Molecular Formula: C30H33BrN6O3

Molecular Weight: 605.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(N)NCCC[C@@H](NC(=O)C=C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](Cc1ccccc1Br)C(N)=O

Standard InChI:  InChI=1S/C30H33BrN6O3/c31-24-15-8-7-14-22(24)18-26(28(32)39)37-29(40)25(16-9-17-35-30(33)34)36-27(38)19-23(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-8,10-15,19,25-26H,9,16-18H2,(H2,32,39)(H,36,38)(H,37,40)(H4,33,34,35)/t25-,26+/m1/s1

Standard InChI Key:  NOTBTEPSIBEBDX-FTJBHMTQSA-N

Molfile:  

 
     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
   13.0365  -15.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0354  -16.2718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7475  -16.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4613  -16.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4585  -15.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7457  -15.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1688  -15.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8821  -15.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5924  -15.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5894  -14.2025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3058  -15.4339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0120  -15.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7253  -15.4286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4356  -15.0132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0089  -14.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7192  -13.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7161  -12.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4264  -12.5493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4233  -11.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1336  -11.3167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.7099  -11.3220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1490  -15.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7284  -16.2499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8593  -15.0079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8562  -14.1865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.5727  -15.4179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1658  -14.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8777  -13.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8750  -12.9808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1611  -12.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4485  -12.9898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4547  -13.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1521  -16.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8655  -16.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8635  -17.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5760  -17.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2873  -17.4662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2816  -16.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5685  -16.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1518  -17.8847    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  6
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 14 22  1  0
 13 23  2  0
 22 24  1  0
 24 25  2  0
 24 26  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  7 27  1  0
 22 33  1  6
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 35 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093771

    ---

Associated Targets(Human)

NPFFR1 Tchem Neuropeptide FF receptor 1 (514 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NPFFR2 Tchem Neuropeptide FF receptor 2 (533 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 605.54Molecular Weight (Monoisotopic): 604.1798AlogP: 2.84#Rotatable Bonds: 13
Polar Surface Area: 163.19Molecular Species: BASEHBA: 4HBD: 6
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.19CX Basic pKa: 11.76CX LogP: 2.86CX LogD: 0.79
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.08Np Likeness Score: -0.09

References

1. Quillet R, Schneider S, Utard V, Drieu la Rochelle A, Elhabazi K, Henningsen JB, Gizzi P, Schmitt M, Kugler V, Simonneaux V, Ilien B, Simonin F, Bihel F..  (2021)  Identification of an N-acylated-DArg-Leu-NH2 Dipeptide as a Highly Selective Neuropeptide FF1 Receptor Antagonist That Potently Prevents Opioid-Induced Hyperalgesia.,  64  (11.0): [PMID:34008968] [10.1021/acs.jmedchem.1c00256]

Source