5-(3,3-dimethylbut-1-ynyl)-2-((1r,4r)-4-hydroxycyclohexylamino)benzamide

ID: ALA5093787

PubChem CID: 141518949

Max Phase: Preclinical

Molecular Formula: C19H26N2O2

Molecular Weight: 314.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)C#Cc1ccc(N[C@H]2CC[C@H](O)CC2)c(C(N)=O)c1

Standard InChI:  InChI=1S/C19H26N2O2/c1-19(2,3)11-10-13-4-9-17(16(12-13)18(20)23)21-14-5-7-15(22)8-6-14/h4,9,12,14-15,21-22H,5-8H2,1-3H3,(H2,20,23)/t14-,15-

Standard InChI Key:  IKFBQHGPTKWOJB-SHTZXODSSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   10.0938   -5.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0926   -6.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8007   -6.4329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5103   -6.0235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5075   -5.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7989   -4.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3860   -4.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3858   -3.9788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6784   -5.2047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7965   -3.9783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5029   -3.5676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2138   -3.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9182   -3.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9200   -2.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2112   -2.3445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5006   -2.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6280   -2.3452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8005   -7.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7927   -8.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7849   -8.8818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0733   -9.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4887   -9.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7803   -9.6949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  6 10  1  0
 11 10  1  1
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  6
  3 18  1  0
 18 19  3  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093787

    ---

Associated Targets(Human)

HSP90AA1 Tchem Heat shock protein HSP 90-alpha (4115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

HSP90B1 Heat shock protein 90 beta (139 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 314.43Molecular Weight (Monoisotopic): 314.1994AlogP: 2.90#Rotatable Bonds: 3
Polar Surface Area: 75.35Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.31CX LogP: 3.38CX LogD: 3.38
Aromatic Rings: 1Heavy Atoms: 23QED Weighted: 0.75Np Likeness Score: -0.46

References

1. Xu S, Guo A, Chen NN, Dai W, Yang HA, Xie W, Wang M, You QD, Xu XL..  (2021)  Design and synthesis of Grp94 selective inhibitors based on Phe199 induced fit mechanism and their anti-inflammatory effects.,  223  [PMID:34174740] [10.1016/j.ejmech.2021.113604]

Source