Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

1-(6,7-Dichloro-9b-((4-(trifluoromethyl)phenyl)amino)-1,3,4,9b-tetrahydro-2H-pyrido[4,3-b]indol-2 yl)-2-hydroxyethan-1-one

ID: ALA5093811

PubChem CID: 166635156

Max Phase: Preclinical

Molecular Formula: C20H16Cl2F3N3O2

Molecular Weight: 458.27

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CO)N1CCC2=Nc3c(ccc(Cl)c3Cl)C2(Nc2ccc(C(F)(F)F)cc2)C1

Standard InChI:  InChI=1S/C20H16Cl2F3N3O2/c21-14-6-5-13-18(17(14)22)26-15-7-8-28(16(30)9-29)10-19(13,15)27-12-3-1-11(2-4-12)20(23,24)25/h1-6,27,29H,7-10H2

Standard InChI Key:  URJWPKRIWFUUQY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   15.3621  -28.3404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8786  -29.0072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2162  -29.7559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1788  -28.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5166  -29.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0385  -29.8401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5285  -30.5009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3030  -29.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3107  -30.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0204  -30.6408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7270  -30.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7193  -29.4036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.0050  -28.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0658  -28.9231    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.7359  -30.4221    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.2972  -28.5976    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4239  -28.9897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1347  -29.3929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8750  -28.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6682  -28.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2458  -27.6469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0309  -26.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2332  -26.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6592  -27.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4178  -28.1725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8393  -28.9790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6059  -26.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3963  -26.4815    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.3905  -25.4856    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.1821  -25.6879    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  9  2  0
  8  5  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  2 14  1  0
  3 15  1  0
  8 16  1  0
 12 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 25  2  0
 18 26  1  0
 22 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093811

    ---

Associated Targets(Human)

THP1-Dual (100 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CGAS Tchem Cyclic GMP-AMP synthase (693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STING1 Tchem Stimulator of interferon genes protein (1885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cgas Cyclic GMP-AMP synthase (121 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Calculated Properties

Molecular Weight: 458.27Molecular Weight (Monoisotopic): 457.0572AlogP: 4.63#Rotatable Bonds: 3
Polar Surface Area: 64.93Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.63CX Basic pKa: 3.25CX LogP: 3.91CX LogD: 3.91
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.71Np Likeness Score: -0.76

References

1. Tan J, Wu B, Chen T, Fan C, Zhao J, Xiong C, Feng C, Xiao R, Ding C, Tang W, Zhang A..  (2021)  Synthesis and Pharmacological Evaluation of Tetrahydro-γ-carboline Derivatives as Potent Anti-inflammatory Agents Targeting Cyclic GMP-AMP Synthase.,  64  (11.0): [PMID:34044539] [10.1021/acs.jmedchem.1c00398]

Source