N-[(5-chloro-8-quinolyl)methyl]-2-[(3R)-tetrahydrofuran-3-yl]ethanamine

ID: ALA5093969

PubChem CID: 166633806

Max Phase: Preclinical

Molecular Formula: C16H19ClN2O

Molecular Weight: 290.79

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Clc1ccc(CNCC[C@@H]2CCOC2)c2ncccc12

Standard InChI:  InChI=1S/C16H19ClN2O/c17-15-4-3-13(16-14(15)2-1-7-19-16)10-18-8-5-12-6-9-20-11-12/h1-4,7,12,18H,5-6,8-11H2/t12-/m1/s1

Standard InChI Key:  ZLUJLVMFUJVXQG-GFCCVEGCSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   -2.7937    1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0791    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3672    1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3672    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0773   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7937    0.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0730   -1.0270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7847   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4984   -1.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5082   -0.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5079    1.4437    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.6530   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0611    0.2066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7753   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4895    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2036   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9566    0.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5082   -0.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0961   -1.1968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2898   -1.0253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  5  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  6 10  1  0
  1 11  1  0
  4 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  6
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5093969

    ---

Associated Targets(Human)

HTR5A Tchem Serotonin 5a (5-HT5a) receptor (1433 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 290.79Molecular Weight (Monoisotopic): 290.1186AlogP: 3.40#Rotatable Bonds: 5
Polar Surface Area: 34.15Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.64CX LogP: 2.72CX LogD: 0.51
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.86Np Likeness Score: -1.00

References

1. Levit Kaplan A, Strachan RT, Braz JM, Craik V, Slocum S, Mangano T, Amabo V, O'Donnell H, Lak P, Basbaum AI, Roth BL, Shoichet BK..  (2022)  Structure-Based Design of a Chemical Probe Set for the 5-HT5A Serotonin Receptor.,  65  (5.0): [PMID:35195401] [10.1021/acs.jmedchem.1c02031]

Source