The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(dimethylamino)-2-oxoethyl 4-(4-((1R,4R,5R)-3-oxo-2-azabicyclo[2.2.1]heptan-5-yl)phenyl)-7-(4-(trifluoromethyl)phenyl)-2-naphthoate ID: ALA5094034
PubChem CID: 166636212
Max Phase: Preclinical
Molecular Formula: C34H29F3N2O4
Molecular Weight: 586.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)COC(=O)c1cc(-c2ccc([C@@H]3C[C@@H]4C[C@H]3C(=O)N4)cc2)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2c1
Standard InChI: InChI=1S/C34H29F3N2O4/c1-39(2)31(40)18-43-33(42)24-14-23-13-22(19-7-10-25(11-8-19)34(35,36)37)9-12-27(23)28(15-24)20-3-5-21(6-4-20)29-16-26-17-30(29)32(41)38-26/h3-15,26,29-30H,16-18H2,1-2H3,(H,38,41)/t26-,29+,30-/m1/s1
Standard InChI Key: BIQFOSBPCMXVKY-JJZPZGAKSA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
0.0000 1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7149 0.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4300 1.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4300 1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7149 2.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1450 2.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8599 1.9112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5750 2.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2900 1.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0049 2.3512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2900 1.1137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5750 0.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0049 0.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1450 3.1487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7149 -0.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7149 -1.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4300 -1.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4300 -0.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7149 -2.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7149 -4.2762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4300 -3.8637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4300 -3.0387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6324 -3.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1450 -2.6262 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1450 -4.2762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7974 -4.0562 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7149 0.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4300 1.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4300 1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7149 2.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1450 2.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8599 1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5750 2.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5750 3.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8599 3.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1450 3.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2900 3.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0049 3.1487 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.8675 4.1387 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 4.2762 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
12 14 1 0
7 15 2 0
3 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 19 1 1
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
22 27 1 0
24 28 1 0
28 27 1 0
27 29 1 1
26 30 2 0
24 31 1 1
2 32 1 0
33 32 2 0
34 33 1 0
35 34 2 0
1 35 1 0
36 34 1 0
37 36 2 0
38 37 1 0
39 38 2 0
40 39 1 0
41 40 2 0
36 41 1 0
39 42 1 0
42 43 1 0
42 44 1 0
42 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.61Molecular Weight (Monoisotopic): 586.2079AlogP: 6.43#Rotatable Bonds: 6Polar Surface Area: 75.71Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.70CX LogD: 5.70Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.26Np Likeness Score: -0.33
References 1. Wen Z, Salmaso V, Jung YH, Phung NB, Gopinatth V, Shah Q, Patterson AT, Randle JCR, Chen Z, Salvemini D, Lieberman DI, Whitehead GS, Karcz TP, Cook DN, Jacobson KA.. (2022) Bridged Piperidine Analogues of a High Affinity Naphthalene-Based P2Y14 R Antagonist., 65 (4.0): [PMID:35113556 ] [10.1021/acs.jmedchem.1c01964 ]