The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((1-Benzyl-3,7-dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)amino)benzoyl)-L-aspartic Acid ID: ALA5094059
PubChem CID: 166631208
Max Phase: Preclinical
Molecular Formula: C25H24N6O7
Molecular Weight: 520.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(Nc2ccc(C(=O)N[C@@H](CC(=O)O)C(=O)O)cc2)nc2c1c(=O)n(Cc1ccccc1)c(=O)n2C
Standard InChI: InChI=1S/C25H24N6O7/c1-29-19-20(30(2)25(38)31(22(19)35)13-14-6-4-3-5-7-14)28-24(29)26-16-10-8-15(9-11-16)21(34)27-17(23(36)37)12-18(32)33/h3-11,17H,12-13H2,1-2H3,(H,26,28)(H,27,34)(H,32,33)(H,36,37)/t17-/m0/s1
Standard InChI Key: JISZZQXBQRQXGX-KRWDZBQOSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
0.6069 -22.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6057 -23.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3205 -23.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0368 -23.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0340 -22.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3187 -21.9148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7520 -23.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4657 -23.1521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1814 -23.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1811 -21.9163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4632 -22.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1811 -24.3901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7487 -21.9156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1826 -21.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8960 -22.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8912 -23.1577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6772 -23.4182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1678 -22.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6849 -22.0785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9927 -22.7558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4093 -22.0438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2357 -22.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6521 -21.3441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2472 -20.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4213 -20.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0004 -21.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9276 -24.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6664 -19.9144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4914 -19.9222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2608 -19.1961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9106 -19.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7354 -19.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1547 -18.5091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1412 -19.9379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5049 -18.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9241 -17.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5184 -17.0647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7490 -17.7908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
8 11 1 0
9 16 1 0
15 10 1 0
10 11 1 0
9 12 2 0
11 13 2 0
10 14 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 2 0
19 15 1 0
18 20 1 0
21 20 1 0
21 22 2 0
21 26 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
17 27 1 0
24 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
31 35 1 1
35 36 1 0
36 37 2 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.50Molecular Weight (Monoisotopic): 520.1706AlogP: 0.88#Rotatable Bonds: 9Polar Surface Area: 177.55Molecular Species: ACIDHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.21CX Basic pKa: ┄CX LogP: 1.78CX LogD: -3.92Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.00
References 1. Lee LC, Peng YH, Chang HH, Hsu T, Lu CT, Huang CH, Hsueh CC, Kung FC, Kuo CC, Jiaang WT, Wu SY.. (2021) Xanthine Derivatives Reveal an Allosteric Binding Site in Methylenetetrahydrofolate Dehydrogenase 2 (MTHFD2)., 64 (15.0): [PMID:34337952 ] [10.1021/acs.jmedchem.1c00663 ] 2. Eadsforth, Thomas C and 13 more authors. 2015-10-22 Characterization of 2,4-Diamino-6-oxo-1,6-dihydropyrimidin-5-yl Ureido Based Inhibitors of Trypanosoma brucei FolD and Testing for Antiparasitic Activity. [PMID:26322631 ]