N-[2-(4-fluoro-1-piperidyl)pyrimidin-4-yl]-3-(4-methoxyphenyl)isoxazol-5-amine

ID: ALA5094076

PubChem CID: 156368886

Max Phase: Preclinical

Molecular Formula: C19H20FN5O2

Molecular Weight: 369.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc(Nc3ccnc(N4CCC(F)CC4)n3)on2)cc1

Standard InChI:  InChI=1S/C19H20FN5O2/c1-26-15-4-2-13(3-5-15)16-12-18(27-24-16)22-17-6-9-21-19(23-17)25-10-7-14(20)8-11-25/h2-6,9,12,14H,7-8,10-11H2,1H3,(H,21,22,23)

Standard InChI Key:  YDEYSHNANNCLOU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    8.5337   -4.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8662   -4.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1212   -3.4680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9462   -3.4680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2012   -4.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9982   -4.4663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5816   -3.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3683   -3.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9506   -2.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7478   -2.7181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9619   -3.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3821   -4.0973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7589   -3.7243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3424   -3.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1394   -3.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3530   -4.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7696   -4.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9725   -4.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1500   -4.3651    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.0692   -4.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8554   -5.2633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0605   -5.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4769   -4.8918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6879   -4.0983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4832   -3.8803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6799   -5.1054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0964   -4.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  5  6  1  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
  7 12  1  0
 13 11  1  0
 13 14  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 13 18  1  0
 16 19  1  0
 20  2  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 20 25  1  0
 23 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5094076

    ---

Associated Targets(Human)

JIMT-1 (237 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 369.40Molecular Weight (Monoisotopic): 369.1601AlogP: 3.82#Rotatable Bonds: 5
Polar Surface Area: 76.31Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.63CX Basic pKa: 5.75CX LogP: 3.41CX LogD: 3.38
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.73Np Likeness Score: -1.58

References

1.  (2021)  Isoxazole derivatives targeting tacc3 as anticancer agents, 

Source