rac-4-(4-(pyrrolidin-3-yl)phenyl)-7-(4-(trifluoromethyl)phenyl)-2-naphthoic acid

ID: ALA5094130

PubChem CID: 164585339

Max Phase: Preclinical

Molecular Formula: C28H22F3NO2

Molecular Weight: 461.48

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1cc(-c2ccc(C3CCNC3)cc2)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2c1

Standard InChI:  InChI=1S/C28H22F3NO2/c29-28(30,31)24-8-5-17(6-9-24)20-7-10-25-22(13-20)14-23(27(33)34)15-26(25)19-3-1-18(2-4-19)21-11-12-32-16-21/h1-10,13-15,21,32H,11-12,16H2,(H,33,34)

Standard InChI Key:  ZBMZKRBRULTTHZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   24.5780   -3.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5768   -4.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2896   -4.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2878   -3.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0012   -3.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0019   -4.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7152   -4.9712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4282   -4.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4235   -3.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7096   -3.3239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1334   -3.3143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8484   -3.7213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1284   -2.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8675   -3.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8687   -2.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1569   -2.0946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4436   -2.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4464   -3.3331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1587   -3.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7305   -2.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7292   -1.2733    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.0187   -2.5085    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.0144   -1.6839    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.7159   -5.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0027   -6.2028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0041   -7.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7180   -7.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4319   -7.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4270   -6.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7208   -8.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0590   -8.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3158   -9.5254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1386   -9.5225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3899   -8.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  1 14  1  0
 17 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  7 24  1  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5094130

    ---

Associated Targets(Human)

TMEM97 Tchem Sigma intracellular receptor 2 (973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
P2RY14 Tchem Purinergic receptor P2Y14 (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRK1 Tclin Kappa opioid receptor (16155 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.48Molecular Weight (Monoisotopic): 461.1603AlogP: 6.97#Rotatable Bonds: 4
Polar Surface Area: 49.33Molecular Species: ZWITTERIONHBA: 2HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.91CX Basic pKa: 10.97CX LogP: 4.06CX LogD: 4.06
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.18

References

1. Wen Z, Salmaso V, Jung YH, Phung NB, Gopinatth V, Shah Q, Patterson AT, Randle JCR, Chen Z, Salvemini D, Lieberman DI, Whitehead GS, Karcz TP, Cook DN, Jacobson KA..  (2022)  Bridged Piperidine Analogues of a High Affinity Naphthalene-Based P2Y14R Antagonist.,  65  (4.0): [PMID:35113556] [10.1021/acs.jmedchem.1c01964]

Source