The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
kalmitoxin-VI ID: ALA509414
PubChem CID: 44559347
Max Phase: Preclinical
Molecular Formula: C24H38O10
Molecular Weight: 486.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Kalmitoxin VI | Kalmitoxin VI|CHEMBL509414|NS00093904
Canonical SMILES: CC(=O)O[C@@H]1[C@@H](O)[C@@]2(O)[C@@H]([C@@H](O)[C@H](O)C2(C)C)[C@](C)(O)[C@@H]2CC[C@@H]3[C@@H](OC(C)=O)[C@]12C[C@@]3(C)O
Standard InChI: InChI=1S/C24H38O10/c1-10(25)33-18-12-7-8-13-22(6,31)15-14(27)16(28)20(3,4)24(15,32)17(29)19(34-11(2)26)23(13,18)9-21(12,5)30/h12-19,27-32H,7-9H2,1-6H3/t12-,13+,14-,15+,16+,17-,18-,19-,21-,22-,23-,24+/m1/s1
Standard InChI Key: RHDHLQKXFJOPEK-GVTFTIFXSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
7.0034 -5.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5769 -7.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4037 -7.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0668 -6.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2609 -5.7135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2394 -6.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7463 -5.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9239 -6.5409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7001 -6.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3072 -6.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1338 -5.4356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3514 -5.1871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1358 -7.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5191 -7.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3131 -6.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4092 -4.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4418 -6.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2333 -7.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2566 -4.8883 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.7463 -4.9140 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.0239 -5.8237 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.9233 -5.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5594 -5.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2045 -7.9257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1084 -5.6118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7598 -7.9374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9121 -7.5935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6917 -8.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8799 -8.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2829 -8.9993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2795 -8.6260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6358 -9.3861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4431 -8.5543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4987 -4.4452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5135 -7.8623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5847 -4.6509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6500 -7.2277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9 10 1 0
10 11 1 0
11 12 1 0
8 13 1 1
10 14 1 0
13 14 1 0
14 15 1 1
1 16 1 1
6 17 1 0
6 18 1 0
5 19 1 6
7 20 1 1
10 21 1 6
23 22 1 0
2 24 1 1
22 25 1 1
5 1 1 0
3 26 1 6
1 7 1 0
9 27 1 1
4 2 1 0
27 28 1 0
8 3 1 0
28 29 1 0
2 3 1 0
28 30 2 0
4 5 1 0
26 31 1 0
5 23 1 0
31 32 1 0
22 6 1 0
31 33 2 0
6 4 1 0
23 34 1 6
7 8 1 0
7 12 1 0
8 9 1 0
1 36 1 0
14 35 1 0
4 37 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.56Molecular Weight (Monoisotopic): 486.2465AlogP: -0.75#Rotatable Bonds: 2Polar Surface Area: 173.98Molecular Species: NEUTRALHBA: 10HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.60CX Basic pKa: ┄CX LogP: -2.06CX LogD: -2.06Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.27Np Likeness Score: 2.69
References 1. El-Naggar SF, Doskotch RW, ODell TM, Girard L. (1980) Antifeedant Diterpenes For the Gypsy Moth Larvae From Kalmia latifolia: Isolation and Characterization of Ten Grayanoids, 43 (5): [10.1021/np50011a016 ]