The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-chloro-N-(4-((3-(prop-2-yn-1-yloxy)phenyl)amino)quinazolin-6-yl)acetamide ID: ALA5094230
PubChem CID: 146451123
Max Phase: Preclinical
Molecular Formula: C19H15ClN4O2
Molecular Weight: 366.81
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOc1cccc(Nc2ncnc3ccc(NC(=O)CCl)cc23)c1
Standard InChI: InChI=1S/C19H15ClN4O2/c1-2-8-26-15-5-3-4-13(9-15)24-19-16-10-14(23-18(25)11-20)6-7-17(16)21-12-22-19/h1,3-7,9-10,12H,8,11H2,(H,23,25)(H,21,22,24)
Standard InChI Key: GUSWAPQBWHGWLI-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
-1.0687 -1.4428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3541 -1.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3577 -1.4425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3577 -2.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3523 -2.6794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0687 -2.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0704 -1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7853 -1.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7872 -2.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0755 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5000 -1.0315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2146 -1.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -1.0315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2146 -2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -2.6819 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.3541 -0.2054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0687 0.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7835 -0.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4956 0.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4956 1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7853 1.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0687 1.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7853 2.2693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4999 2.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2146 2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9292 1.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
4 10 1 0
8 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
2 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 366.81Molecular Weight (Monoisotopic): 366.0884AlogP: 3.56#Rotatable Bonds: 6Polar Surface Area: 76.14Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.29CX Basic pKa: 3.98CX LogP: 3.30CX LogD: 3.30Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.51Np Likeness Score: -1.96
References 1. (2020) Novel inhibitors of guanosine monophosphate synthetase as therapeutic agents,