2-cyclohexyl-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(methylamino)propan-1-one

ID: ALA5094457

PubChem CID: 166634468

Max Phase: Preclinical

Molecular Formula: C24H33N3O5S

Molecular Weight: 475.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCC(C(=O)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCO3)C2)C1CCCCC1

Standard InChI:  InChI=1S/C24H33N3O5S/c1-25-12-21(17-5-3-2-4-6-17)24(28)26-13-18-15-27(16-19(18)14-26)33(29,30)20-7-8-22-23(11-20)32-10-9-31-22/h7-8,11,17,21,25H,2-6,9-10,12-16H2,1H3

Standard InChI Key:  CWGUXSNSABCTDV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -3.5942   -0.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5942   -0.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8809   -1.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1738   -0.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1738   -0.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8827    0.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4595   -1.2528    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7452   -0.8404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6591   -0.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1472    0.1508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5593   -0.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0077   -1.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3656   -0.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4518    0.4280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6987    0.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1661    0.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1661    1.6651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8804    0.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5946    0.8404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4595   -2.0775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7452   -1.6651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3087   -1.2565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0232   -0.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0232   -0.0190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3087    0.3933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8804   -0.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5946   -0.8090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5946   -1.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5947    1.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3089    2.0775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0232    1.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0232    0.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3089    0.4280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 14 13  1  0
 15 14  1  0
 10 15  1  0
 14 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
  7 20  2  0
  7 21  2  0
  2 22  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
  1 25  1  0
 18 26  1  0
 26 27  1  0
 27 28  1  0
 29 19  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 19 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5094457

    ---

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.61Molecular Weight (Monoisotopic): 475.2141AlogP: 2.02#Rotatable Bonds: 6
Polar Surface Area: 88.18Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.83CX LogP: 1.16CX LogD: -1.21
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.63Np Likeness Score: -0.60

References

1.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 

Source