(2S)-1-(5-chroman-7-ylsulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl)-2-hydroxy-2-phenyl-ethanone

ID: ALA5094476

PubChem CID: 166634795

Max Phase: Preclinical

Molecular Formula: C23H24N2O5S

Molecular Weight: 440.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C([C@@H](O)c1ccccc1)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCC3)C2

Standard InChI:  InChI=1S/C23H24N2O5S/c26-22(17-5-2-1-3-6-17)23(27)24-12-18-14-25(15-19(18)13-24)31(28,29)20-9-8-16-7-4-10-30-21(16)11-20/h1-3,5-6,8-9,11,22,26H,4,7,10,12-15H2/t22-/m0/s1

Standard InChI Key:  FZKFAGOMNOCXLJ-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -3.5944   -0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5944   -0.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8811   -1.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1739   -0.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1739   -0.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8828    0.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4597   -1.2518    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454   -0.8395    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6593   -0.0196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1470    0.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5592   -0.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0075   -1.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3655   -0.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4517    0.4289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6986    0.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1659    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1659    1.6660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8802    0.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5945    0.8413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4597   -2.0766    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454   -1.6642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3088   -1.2556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0233   -0.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0233   -0.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3088    0.3942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8802   -0.3958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5948    1.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3073    2.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0217    1.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0233    0.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3118    0.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 14 13  1  0
 15 14  1  0
 10 15  1  0
 14 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
  7 20  2  0
  7 21  2  0
  2 22  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
  1 25  1  0
 18 26  1  6
 27 19  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 19 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5094476

    ---

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.52Molecular Weight (Monoisotopic): 440.1406AlogP: 1.89#Rotatable Bonds: 4
Polar Surface Area: 87.15Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.45CX Basic pKa: CX LogP: 1.21CX LogD: 1.21
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.73Np Likeness Score: -0.62

References

1.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 

Source