The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Fisetinidol-(4beta->8)-epigallocatechin ID: ALA5094479
PubChem CID: 166634798
Max Phase: Preclinical
Molecular Formula: C30H26O12
Molecular Weight: 578.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Oc1ccc2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)C2
Standard InChI: InChI=1S/C30H26O12/c31-13-2-3-14-23(8-13)41-29(11-1-4-16(32)18(34)5-11)27(40)24(14)25-19(35)10-17(33)15-9-22(38)28(42-30(15)25)12-6-20(36)26(39)21(37)7-12/h1-8,10,22,24,27-29,31-40H,9H2/t22-,24-,27+,28-,29-/m1/s1
Standard InChI Key: PLZSOHLBNUGAIX-LEDIDPADSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
-3.2123 1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4978 1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7859 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7859 0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4959 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2123 0.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0712 1.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3566 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3566 0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0712 -0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3580 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3582 2.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0711 2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7859 2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7875 1.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0756 1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0712 -1.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3567 -1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 -2.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0723 -2.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7842 -2.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7889 -1.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3561 -1.0337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0682 -1.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0675 -2.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3546 -2.6791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7829 -1.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7831 -0.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4959 0.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2108 -0.2099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2124 -1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5006 -1.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7821 -2.6811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5036 -1.0333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0723 -3.5050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3580 -0.2064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9270 1.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5006 2.6797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9255 0.2025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9270 -1.4436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4959 1.0278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0711 3.5050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
4 10 1 0
8 11 1 6
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
11 16 1 0
16 15 2 0
10 17 1 1
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
17 22 1 0
22 21 2 0
18 23 1 0
24 23 1 0
25 24 1 0
26 25 1 0
19 26 1 0
24 27 1 6
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
27 32 1 0
32 31 2 0
25 33 1 6
22 34 1 0
20 35 1 0
9 36 1 1
1 37 1 0
14 38 1 0
30 39 1 0
31 40 1 0
29 41 1 0
13 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.53Molecular Weight (Monoisotopic): 578.1424AlogP: 3.00#Rotatable Bonds: 3Polar Surface Area: 220.76Molecular Species: NEUTRALHBA: 12HBD: 10#RO5 Violations: 3HBA (Lipinski): 12HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.56CX Basic pKa: ┄CX LogP: 3.12CX LogD: 3.09Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.16Np Likeness Score: 2.06
References 1. Munsimbwe L, Suganuma K, Ishikawa Y, Choongo K, Kikuchi T, Shirakura I, Murata T.. (2022) Benzophenone Glucosides and B-Type Proanthocyanidin Dimers from Zambian Cassia abbreviata and Their Trypanocidal Activities., 85 (1.0): [PMID:34965114 ] [10.1021/acs.jnatprod.1c00738 ]