The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl]-phenyl-methanol ID: ALA5094485
PubChem CID: 163739907
Max Phase: Preclinical
Molecular Formula: C23H22N2O3
Molecular Weight: 374.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: OC(c1ccccc1)c1cc2c(cn1)CN(Cc1ccc3c(c1)OCCO3)C2
Standard InChI: InChI=1S/C23H22N2O3/c26-23(17-4-2-1-3-5-17)20-11-18-14-25(15-19(18)12-24-20)13-16-6-7-21-22(10-16)28-9-8-27-21/h1-7,10-12,23,26H,8-9,13-15H2
Standard InChI Key: LGWCRINZAKHQKI-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
0.3643 -1.3613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0787 -1.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7933 -1.3617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5076 -1.7744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2222 -1.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2224 -0.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5081 -0.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7935 -0.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6514 -0.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9370 -0.1248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6512 -1.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9366 -1.7747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3892 -1.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9410 -1.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5284 -0.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2783 -0.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7633 -1.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1758 -0.3683 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7669 0.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9426 0.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1793 1.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0040 1.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4166 0.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2389 0.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6514 1.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2425 1.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4181 1.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7669 1.7717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
8 3 2 0
7 8 1 0
9 10 1 0
6 10 1 0
11 9 1 0
12 11 1 0
5 12 1 0
13 1 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 1 1 0
14 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
19 21 1 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
21 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.44Molecular Weight (Monoisotopic): 374.1630AlogP: 3.45#Rotatable Bonds: 4Polar Surface Area: 54.82Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.05CX Basic pKa: 5.48CX LogP: 2.94CX LogD: 2.93Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.76Np Likeness Score: -0.59
References 1. (2020) Inhibiting ubiquitin specific peptidase 9x,