N-[[(3R)-1-[(2S)-2-hydroxy-2-phenyl-acetyl]pyrrolidin-3-yl]methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide

ID: ALA5094541

PubChem CID: 153550947

Max Phase: Preclinical

Molecular Formula: C21H24N2O6S

Molecular Weight: 432.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C([C@@H](O)c1ccccc1)N1CC[C@@H](CNS(=O)(=O)c2ccc3c(c2)OCCO3)C1

Standard InChI:  InChI=1S/C21H24N2O6S/c24-20(16-4-2-1-3-5-16)21(25)23-9-8-15(14-23)13-22-30(26,27)17-6-7-18-19(12-17)29-11-10-28-18/h1-7,12,15,20,22,24H,8-11,13-14H2/t15-,20-/m0/s1

Standard InChI Key:  GLZQZIBXLCIBMY-YWZLYKJASA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -3.9313    0.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9313   -0.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2180   -0.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5108   -0.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5108    0.5858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2197    0.9960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7966   -0.6482    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0823   -0.2358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7966   -1.4729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0823   -1.0605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6457   -0.6519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3602   -0.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3602    0.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6457    0.9979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3680   -0.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3462   -0.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4323    0.5839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2387    0.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6509    0.0413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0992   -0.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4756    0.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8880   -0.6728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8881    0.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7128    0.7555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4756    1.4699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1254    0.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9477    0.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3602    0.7566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9513    1.4681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1270    1.4729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  1  0
  7  9  2  0
  7 10  2  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  1 14  1  0
  8 15  1  0
 16 15  1  6
 17 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
 19 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 25  1  1
 26 24  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 24 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5094541

    ---

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.50Molecular Weight (Monoisotopic): 432.1355AlogP: 1.32#Rotatable Bonds: 6
Polar Surface Area: 105.17Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.26CX Basic pKa: CX LogP: 0.75CX LogD: 0.75
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.71Np Likeness Score: -1.30

References

1.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 

Source