The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[[(3R)-1-[(2S)-2-hydroxy-2-phenyl-acetyl]pyrrolidin-3-yl]methyl]-2,3-dihydro-1,4-benzodioxine-6-sulfonamide ID: ALA5094541
PubChem CID: 153550947
Max Phase: Preclinical
Molecular Formula: C21H24N2O6S
Molecular Weight: 432.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C([C@@H](O)c1ccccc1)N1CC[C@@H](CNS(=O)(=O)c2ccc3c(c2)OCCO3)C1
Standard InChI: InChI=1S/C21H24N2O6S/c24-20(16-4-2-1-3-5-16)21(25)23-9-8-15(14-23)13-22-30(26,27)17-6-7-18-19(12-17)29-11-10-28-18/h1-7,12,15,20,22,24H,8-11,13-14H2/t15-,20-/m0/s1
Standard InChI Key: GLZQZIBXLCIBMY-YWZLYKJASA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-3.9313 0.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9313 -0.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2180 -0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5108 -0.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5108 0.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2197 0.9960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7966 -0.6482 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0823 -0.2358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7966 -1.4729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0823 -1.0605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6457 -0.6519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3602 -0.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3602 0.5855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6457 0.9979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3680 -0.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3462 -0.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4323 0.5839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2387 0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6509 0.0413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0992 -0.5712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4756 0.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8880 -0.6728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8881 0.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7128 0.7555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4756 1.4699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1254 0.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9477 0.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3602 0.7566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9513 1.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1270 1.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
4 7 1 0
7 8 1 0
7 9 2 0
7 10 2 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
1 14 1 0
8 15 1 0
16 15 1 6
17 16 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 16 1 0
19 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
23 25 1 1
26 24 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
24 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.50Molecular Weight (Monoisotopic): 432.1355AlogP: 1.32#Rotatable Bonds: 6Polar Surface Area: 105.17Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.26CX Basic pKa: ┄CX LogP: 0.75CX LogD: 0.75Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.71Np Likeness Score: -1.30
References 1. (2020) Inhibiting ubiquitin specific peptidase 9x,