3-(cyclopentylmethylamino)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-phenyl-propan-1-one

ID: ALA5094550

PubChem CID: 146446250

Max Phase: Preclinical

Molecular Formula: C29H35N3O5S

Molecular Weight: 537.68

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(C(CNCC1CCCC1)c1ccccc1)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCO3)C2

Standard InChI:  InChI=1S/C29H35N3O5S/c33-29(26(22-8-2-1-3-9-22)16-30-15-21-6-4-5-7-21)31-17-23-19-32(20-24(23)18-31)38(34,35)25-10-11-27-28(14-25)37-13-12-36-27/h1-3,8-11,14,21,26,30H,4-7,12-13,15-20H2

Standard InChI Key:  NNQDGMKPCOUZTA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -3.5943    0.4617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5943   -0.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8810   -0.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1739   -0.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1739    0.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8828    0.8722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4596   -0.7719    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454   -0.3595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6592    0.4602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1471    0.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5592   -0.0822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0076   -0.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3655    0.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4517    0.9089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6986    1.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1660    1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1660    2.1460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8803    0.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5945    1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3119    0.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0233    1.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0218    2.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3073    2.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5948    2.1461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8803    0.0842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4596   -1.5966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7454   -1.1842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3088   -0.7756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3088    0.8742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0233    0.4618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0233   -0.3631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1660   -0.3282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1660   -1.1529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4517   -1.5652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3656   -2.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5592   -2.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1470   -1.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6987   -1.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 14 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 22 21  1  0
 22 23  2  0
 23 24  1  0
 24 19  2  0
 18 25  1  0
  7 26  2  0
  7 27  2  0
  2 28  1  0
  1 29  1  0
 30 29  1  0
 30 31  1  0
 28 31  1  0
 25 32  1  0
 32 33  1  0
 33 34  1  0
 35 34  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5094550

    ---

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.68Molecular Weight (Monoisotopic): 537.2297AlogP: 3.16#Rotatable Bonds: 8
Polar Surface Area: 88.18Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.85CX LogP: 2.37CX LogD: -0.02
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.52Np Likeness Score: -0.83

References

1.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 

Source