The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(cyclopentylmethylamino)-1-[5-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-2-phenyl-propan-1-one ID: ALA5094550
PubChem CID: 146446250
Max Phase: Preclinical
Molecular Formula: C29H35N3O5S
Molecular Weight: 537.68
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(C(CNCC1CCCC1)c1ccccc1)N1CC2=C(C1)CN(S(=O)(=O)c1ccc3c(c1)OCCO3)C2
Standard InChI: InChI=1S/C29H35N3O5S/c33-29(26(22-8-2-1-3-9-22)16-30-15-21-6-4-5-7-21)31-17-23-19-32(20-24(23)18-31)38(34,35)25-10-11-27-28(14-25)37-13-12-36-27/h1-3,8-11,14,21,26,30H,4-7,12-13,15-20H2
Standard InChI Key: NNQDGMKPCOUZTA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-3.5943 0.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5943 -0.3632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8810 -0.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1739 -0.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1739 0.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8828 0.8722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4596 -0.7719 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.7454 -0.3595 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6592 0.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1471 0.6317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5592 -0.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0076 -0.6948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3655 0.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4517 0.9089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6986 1.2442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1660 1.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1660 2.1460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8803 0.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5945 1.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3119 0.9071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0233 1.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0218 2.1440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3073 2.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5948 2.1461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8803 0.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4596 -1.5966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7454 -1.1842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3088 -0.7756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3088 0.8742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0233 0.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0233 -0.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1660 -0.3282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1660 -1.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4517 -1.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3656 -2.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5592 -2.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1470 -1.8426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6987 -1.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
11 13 1 0
13 14 1 0
14 15 1 0
10 15 1 0
14 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
22 21 1 0
22 23 2 0
23 24 1 0
24 19 2 0
18 25 1 0
7 26 2 0
7 27 2 0
2 28 1 0
1 29 1 0
30 29 1 0
30 31 1 0
28 31 1 0
25 32 1 0
32 33 1 0
33 34 1 0
35 34 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.68Molecular Weight (Monoisotopic): 537.2297AlogP: 3.16#Rotatable Bonds: 8Polar Surface Area: 88.18Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.85CX LogP: 2.37CX LogD: -0.02Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.52Np Likeness Score: -0.83
References 1. (2020) Inhibiting ubiquitin specific peptidase 9x,